Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1COP(=O)(NC1O)N(CCCl)CCCl |
|---|---|
| IUPAC Name | 2-[bis(2-chloroethyl)amino]-2-oxo-1,3,2\u03bb5-oxazaphosphinan-4-ol |
| InChIKey | RANONBLIHMVXAJ-UHFFFAOYSA-N |
| INCHI | 1S/C7H15Cl2N2O3P/c8-2-4-11(5-3-9)15(13)10-7(12)1-6-14-15/h7,12H,1-6H2,(H,10,13) |
| Isomeric SMILES | C1COP(=O)(NC1O)N(CCCl)CCCl |
| Alternate CAS | 40277-05-2 |
| PubChem CID | 99735 |
| NSC Number | 196562 |
| MeSH Entry Terms | 4-hydroxycyclophosphamide;4-hydroxycyclophosphamide, (cis)-isomer;4-hydroxycyclophosphamide, (trans)-isomer;NSC 196562 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Class | Organonitrogen compounds |
| Subclass | Nitrogen mustard compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitrogen mustard compounds |
| Alternative Parents | Phosphoric monoester diamides Oxazaphosphinanes Oxacyclic compounds Azacyclic compounds Alkanolamines Organopnictogen compounds Organooxygen compounds Organochlorides Organic oxides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Nitrogen mustard - Phosphoric monoester diamide - Organic phosphoric acid derivative - Oxazaphosphinane - Organic phosphoric acid amide - Azacycle - Organoheterocyclic compound - Alkanolamine - Oxacycle - Alkyl chloride - Organopnictogen compound - Organooxygen compound - Organochloride - Organohalogen compound - Organic oxygen compound - Alkyl halide - Hydrocarbon derivative - Organic oxide - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitrogen mustard compounds. These are compounds having two beta-haloalkyl groups bound to a nitrogen atom. |
| External Descriptors | organochlorine compound - nitrogen mustard - phosphorodiamide |
| Molecular Weight | 277.080 g/mol |
|---|---|
| XLogP3 | 0.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 5 |
| Exact Mass | 276.02 Da |
| Monoisotopic Mass | 276.02 Da |
| Topological Polar Surface Area | 61.800 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 238.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |