Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| alogp | 3.2 |
|---|
| Canonical Smiles | CCOP(=S)(OCC)SCN1C(=O)SC(=N1)OC |
|---|---|
| IUPAC Name | 3-(diethoxyphosphinothioylsulfanylmethyl)-5-methoxy-1,3,4-thiadiazol-2-one |
| InChIKey | QAOFKYGUSMPWNY-UHFFFAOYSA-N |
| INCHI | 1S/C8H15N2O4PS3/c1-4-13-15(16,14-5-2)17-6-10-8(11)18-7(9-10)12-3/h4-6H2,1-3H3 |
| Isomeric SMILES | CCOP(=S)(OCC)SCN1C(=O)SC(=N1)OC |
| PubChem CID | 88197 |
| Molecular Weight | 330.4 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Azoles |
| Subclass | Thiadiazoles |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 1,3,4-thiadiazol-3-yl-organothiophosphates |
| Alternative Parents | Alkyl aryl ethers Dithiophosphate S-esters Dithiophosphate O-esters Heteroaromatic compounds Sulfenyl compounds Organothiophosphorus compounds Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | 1,3,4-thiadiazol-3-yl-organothiophosphate - Alkyl aryl ether - Dithiophosphate s-ester - Dithiophosphate o-ester - Heteroaromatic compound - Organic dithiophosphate - Azacycle - Sulfenyl compound - Organothiophosphorus compound - Ether - Organic oxide - Hydrocarbon derivative - Organic nitrogen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as 1,3,4-thiadiazol-3-yl-organothiophosphates. These are aromatic heterocyclic compounds containing a 1,3,4-thiadiazole ring, which is substituted at the 2-position with an organothiophosphate group. |
| External Descriptors | Organophosphorus insecticides |
| Molecular Weight | 330.400 g/mol |
|---|---|
| XLogP3 | 3.200 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 8 |
| Rotatable Bond Count | 8 |
| Exact Mass | 329.993 Da |
| Monoisotopic Mass | 329.993 Da |
| Topological Polar Surface Area | 143.000 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 369.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |