Determine the necessary mass, volume, or concentration for preparing a solution.
≥98 atom% D,≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Room temperature,Argon charged Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488198325 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488198325 |
| Canonical Smiles | C1CCC(=O)CC1 |
| IUPAC Name | 2,2,6,6-tetradeuteriocyclohexan-1-one |
| InChIKey | JHIVVAPYMSGYDF-CQOLUAMGSA-N |
| INCHI | 1S/C6H10O/c7-6-4-2-1-3-5-6/h1-5H2/i4D2,5D2 |
| Isomeric SMILES | [2H]C1(CCCC(C1=O)([2H])[2H])[2H] |
| UN Number | 1915 |
| Packing Group | III |
| Molecular Weight | 102.17 |
| Reaxy-Rn | 385735 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=385735&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Class | Organooxygen compounds |
| Subclass | Carbonyl compounds |
| Intermediate Tree Nodes | Ketones |
| Direct Parent | Cyclic ketones |
| Alternative Parents | Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cyclic ketone - Organic oxide - Hydrocarbon derivative - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cyclic ketones. These are organic compounds containing a ketone that is conjugated to a cyclic moiety. |
| External Descriptors | Not available |
| Sensitivity | Moisture sensitive;Light sensitive |
|---|---|
| x_refractive_index | n20D1.45 (lit.) |
| x_boil_point_char | 153° C (lit.) |
| x_melt_point_char | -47° C (lit.) |
| Molecular Weight | 102.170 g/mol |
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 102.098 Da |
| Monoisotopic Mass | 102.098 Da |
| Topological Polar Surface Area | 17.100 Ų |
| Heavy Atom Count | 7 |
| Formal Charge | 0 |
| Complexity | 68.200 |
| Isotope Atom Count | 4 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Liu Xiang, Zhu Yu-Quan, Li Jing, Wang Ye, Shi Qiujin, Li An-Zhen, Ji Kaiyue, Wang Xi, Zhao Xikang, Zheng Jinyu, Duan Haohong. (2024) Electrosynthesis of adipic acid with high faradaic efficiency within a wide potential window. Nature Communications, 15 (1): (1-16). [PMID:39227577] [10.1038/s41467-024-51951-0] |