Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sourires canoniques | CC1=CN(C(=O)NC1=O)C2CCC(O2)COP(=O)(O)O |
|---|---|
| IUPAC Name | [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl dihydrogen phosphate |
| InChIKey | WVNRRNJFRREKAR-JGVFFNPUSA-N |
| INCHI | 1S/C10H15N2O7P/c1-6-4-12(10(14)11-9(6)13)8-3-2-7(19-8)5-18-20(15,16)17/h4,7-8H,2-3,5H2,1H3,(H,11,13,14)(H2,15,16,17)/t7-,8+/m0/s1 |
| Isomères SMILES | CC1=CN(C(=O)NC1=O)[C@H]2CC[C@H](O2)COP(=O)(O)O |
| PubChem CID | 165151 |
| Poids moléculaire | 306.211 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Nucleosides, nucleotides, and analogues |
| Classe | Pyrimidine nucleotides |
| Subclass | Pyrimidine deoxyribonucleotides |
| Intermediate Tree Nodes | Pyrimidine deoxyribonucleoside monophosphates |
| Direct Parent | Pyrimidine 2',3'-dideoxyribonucleoside monophosphates |
| Alternative Parents | Pyrimidones Monoalkyl phosphates Hydropyrimidines Vinylogous amides Tetrahydrofurans Heteroaromatic compounds Ureas Lactams Oxacyclic compounds Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Pyrimidine 2',3'-dideoxyribonucleoside monophosphate - Pyrimidone - Monoalkyl phosphate - Hydropyrimidine - Organic phosphoric acid derivative - Phosphoric acid ester - Pyrimidine - Alkyl phosphate - Vinylogous amide - Tetrahydrofuran - Heteroaromatic compound - Urea - Lactam - Organoheterocyclic compound - Azacycle - Oxacycle - Organopnictogen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Aromatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as pyrimidine 2',3'-dideoxyribonucleoside monophosphates. These are pyrimidine nucleotides with monophosphate group linked to the ribose moiety lacking a hydroxyl group at positions 2 and 3. |
| External Descriptors | thymidine phosphate - pyrimidine 2',3'-dideoxyribonucleoside monophosphate |
| Poids moléculaire | 306.210 g/mol |
|---|---|
| XLogP3 | -2.800 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 4 |
| Exact Mass | 306.062 Da |
| Monoisotopic Mass | 306.062 Da |
| Topological Polar Surface Area | 125.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 500.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |