Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sourires canoniques | C[N+](C)(C)CCC1=CNC2=C1C=C(C=C2)O |
|---|---|
| IUPAC Name | 2-(5-hydroxy-1H-indol-3-yl)ethyl-trimethylazanium |
| InChIKey | HIYGARYIJIZXGW-UHFFFAOYSA-O |
| INCHI | 1S/C13H18N2O/c1-15(2,3)7-6-10-9-14-13-5-4-11(16)8-12(10)13/h4-5,8-9,14H,6-7H2,1-3H3/p+1 |
| Isomères SMILES | C[N+](C)(C)CCC1=CNC2=C1C=C(C=C2)O |
| CAS alternatif | 60657-23-0 |
| PubChem CID | 656705 |
| Termes d'entrée MeSH | bufotenium;cinobufotenine;cinobufotenine bromide;cinobufotenine chloride |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Classe | Indoles and derivatives |
| Subclass | Tryptamines and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Serotonins |
| Alternative Parents | Hydroxyindoles 3-alkylindoles Alkaloids and derivatives Aralkylamines 1-hydroxy-2-unsubstituted benzenoids Substituted pyrroles Tetraalkylammonium salts Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organic salts Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Serotonin - 3-alkylindole - Hydroxyindole - Indole - Alkaloid or derivatives - 1-hydroxy-2-unsubstituted benzenoid - Aralkylamine - Substituted pyrrole - Benzenoid - Pyrrole - Quaternary ammonium salt - Tetraalkylammonium salt - Heteroaromatic compound - Azacycle - Organic nitrogen compound - Organopnictogen compound - Organic oxygen compound - Amine - Organooxygen compound - Hydrocarbon derivative - Organic salt - Organonitrogen compound - Organic cation - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as serotonins. These are compounds containing a serotonin moiety, which consists of an indole that bears an aminoethyl a position 2 and a hydroxyl group at position 5. |
| External Descriptors | citraconoyl group |
| Poids moléculaire | 219.300 g/mol |
|---|---|
| XLogP3 | 1.200 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 3 |
| Exact Mass | 219.15 Da |
| Monoisotopic Mass | 219.15 Da |
| Topological Polar Surface Area | 36.000 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 1 |
| Complexity | 237.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |