Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sourires canoniques | CCN(CC)CCNC1=C2C3=C(C=C1)N=CN3C4=C(C2=O)C=C(C=C4)O |
|---|---|
| IUPAC Name | 10-[2-(diethylamino)ethylamino]-5-hydroxy-1,14-diazatetracyclo[7.6.1.02,7.013,16]hexadeca-2(7),3,5,9,11,13(16),14-heptaen-8-one |
| InChIKey | CUNDRHORZHFPLY-UHFFFAOYSA-N |
| INCHI | 1S/C20H22N4O2/c1-3-23(4-2)10-9-21-15-6-7-16-19-18(15)20(26)14-11-13(25)5-8-17(14)24(19)12-22-16/h5-8,11-12,21,25H,3-4,9-10H2,1-2H3 |
| Isomères SMILES | CCN(CC)CCNC1=C2C3=C(C=C1)N=CN3C4=C(C2=O)C=C(C=C4)O |
| WGK Allemagne | 3 |
| PubChem CID | 132127 |
| Poids moléculaire | 350.41 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Classe | Quinolines and derivatives |
| Subclass | Benzoquinolines |
| Intermediate Tree Nodes | Acridines |
| Direct Parent | Acridones |
| Alternative Parents | Aminoquinolines and derivatives Hydroquinolones Hydroxyquinolines Hydroquinolines Benzimidazoles 1-hydroxy-2-unsubstituted benzenoids Secondary alkylarylamines Pyridines and derivatives N-substituted imidazoles Vinylogous amides Heteroaromatic compounds Trialkylamines Azacyclic compounds Hydrocarbon derivatives Organopnictogen compounds Organooxygen compounds Organic oxides |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Acridone - Aminoquinoline - Dihydroquinolone - Hydroxyquinoline - Dihydroquinoline - Benzimidazole - 1-hydroxy-2-unsubstituted benzenoid - Secondary aliphatic/aromatic amine - Benzenoid - Pyridine - N-substituted imidazole - Vinylogous amide - Heteroaromatic compound - Azole - Imidazole - Tertiary aliphatic amine - Tertiary amine - Secondary amine - Azacycle - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Amine - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as acridones. These are acridines containing a ketone group attached to the C9 carbon atom of the acridine moiety. |
| External Descriptors | Not available |
| Poids moléculaire | 350.400 g/mol |
|---|---|
| XLogP3 | 3.600 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 6 |
| Exact Mass | 350.174 Da |
| Monoisotopic Mass | 350.174 Da |
| Topological Polar Surface Area | 70.400 Ų |
| Heavy Atom Count | 26 |
| Formal Charge | 0 |
| Complexity | 512.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |