Determine the necessary mass, volume, or concentration for preparing a solution.
≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 4 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Cellulotriose is a 3-glucose polymer cellulodextrin derived from cellulose degradation. Cellotriose and other cellulodextrins, such as cellulobiose, cellotetraose and cellopentaose are used by cellulosic bacteria as sources of energy. Cellotriose is used to help identify, differentiate and characterize oligosaccharide metabolizing enzymes.
| Pubchem Sid | 528763987 |
|---|---|
| Sourires canoniques | OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O[C@@H]2CO)O[C@H]3[C@H](O)[C@@H](O)C(O)O[C@@H]3CO)[C@H](O)[C@@H](O)[C@@H]1O |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2R,3S,4R,5R,6S)-4,5-dihydroxy-2-(hydroxymethyl)-6-[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChIKey | FYGDTMLNYKFZSV-ZWSAEMDYSA-N |
| INCHI | 1S/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16?,17+,18+/m1/s1 |
| Isomères SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O[C@@H]3[C@H](OC([C@@H]([C@H]3O)O)O)CO)CO)O)O)O)O |
| WGK Allemagne | 3 |
| Poids moléculaire | 504.44 |
| Beilstein | 100353 |
| Reaxy-Rn | 1443480 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1443480&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Classe | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Oligosaccharides |
| Alternative Parents | O-glycosyl compounds Oxanes Secondary alcohols Hemiacetals Polyols Oxacyclic compounds Acetals Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Oligosaccharide - O-glycosyl compound - Glycosyl compound - Oxane - Secondary alcohol - Hemiacetal - Oxacycle - Organoheterocyclic compound - Polyol - Acetal - Hydrocarbon derivative - Primary alcohol - Alcohol - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds. |
| External Descriptors | trisaccharide |
| Solubilité | Soluble in water (50 mg/ml), and methanol., Soluble in water (50 mg/ml), and methanol. |
|---|---|
| Rotation spécifique [α] | 24° (C=1,H2O) |
| Point de fusion (°C) | 209°C(lit.) |
| Poids moléculaire | 504.400 g/mol |
| XLogP3 | -6.900 |
| Hydrogen Bond Donor Count | 11 |
| Hydrogen Bond Acceptor Count | 16 |
| Rotatable Bond Count | 7 |
| Exact Mass | 504.169 Da |
| Monoisotopic Mass | 504.169 Da |
| Topological Polar Surface Area | 269.000 Ų |
| Heavy Atom Count | 34 |
| Formal Charge | 0 |
| Complexity | 641.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 14 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Zheng Jiang, Hong Wang, Miao Yu, Cheng Qu, Wei Yue, Qinan Wu. (2023) A low-cost efficient online derivatization system for the determination of saccharides by high-performance liquid chromatograph-ultraviolet detector. JOURNAL OF SEPARATION SCIENCE, 46 (20): (2300384). [PMID:37691057] [10.1002/jssc.202300384] |
| 2. Weiyang Zhang, Jing Cai, Wenqing Gao, Renlu Han, Haixing Wang, Yanfei Wu, Jiawei Wu, Yong Wu, Chenlu Wang, Keqi Tang, Jiancheng Yu. (2023) Overlapping peak separation algorithm for ion mobility spectra based on multistrategy JAYA. RAPID COMMUNICATIONS IN MASS SPECTROMETRY, 37 (18): (e9603). [PMID:37580846] [10.1002/rcm.9603] |
| 3. Xu Tang, Jiangcheng Yu, Zhijun Xie, Keqi Tang, Shifu Hu, Jun Li, Yong Wu. (2022) Deconvolution of overlapping peaks in ion mobility spectrometry based on a multiobjective dynamic teaching-learning-based optimization. RAPID COMMUNICATIONS IN MASS SPECTROMETRY, 37 (1): (e9379). [PMID:35986906] [10.1002/rcm.9379] |
| 4. Dongdong Meng, Xinlei Wei, Yi-Heng P. Job Zhang, Zhiguang Zhu, Chun You, Yanhe Ma. (2018) Stoichiometric Conversion of Cellulosic Biomass by in Vitro Synthetic Enzymatic Biosystems for Biomanufacturing. ACS Catalysis, [PMID:] [10.1021/acscatal.8b02473] |