Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sourires canoniques | C(CCl)N(CCCl)CC1C(C(C(C(O1)O)O)O)O |
|---|---|
| IUPAC Name | (3R,4S,5R,6R)-6-[bis(2-chloroethyl)aminomethyl]oxane-2,3,4,5-tetrol |
| InChIKey | COKGUJJIBXWRNV-CYNREMDZSA-N |
| INCHI | 1S/C10H19Cl2NO5/c11-1-3-13(4-2-12)5-6-7(14)8(15)9(16)10(17)18-6/h6-10,14-17H,1-5H2/t6-,7+,8+,9-,10?/m1/s1 |
| Isomères SMILES | C(CCl)N(CCCl)C[C@@H]1[C@@H]([C@@H]([C@H](C(O1)O)O)O)O |
| CAS alternatif | 105618-02-8,107811-63-2 (hydrochloride) |
| PubChem CID | 65891 |
| Termes d'entrée MeSH | 6-(bis(2-chloroethyl)amino)-6-deoxygalactopyranose;6-bis-(2-chloroethyl)amino-6-deoxygalactopyranose;C6-galactose mustard;C6-galactose mustard hydrochloride;C6-GLM;galactose-6-mustard |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic nitrogen compounds |
| Classe | Organonitrogen compounds |
| Subclass | Nitrogen mustard compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitrogen mustard compounds |
| Alternative Parents | Aminosaccharides Oxanes Monosaccharides Trialkylamines Secondary alcohols Hemiacetals Polyols Oxacyclic compounds Organopnictogen compounds Organochlorides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Nitrogen mustard - Amino saccharide - Monosaccharide - Oxane - Tertiary aliphatic amine - Tertiary amine - Secondary alcohol - Hemiacetal - Organoheterocyclic compound - Oxacycle - Polyol - Hydrocarbon derivative - Organooxygen compound - Organochloride - Organohalogen compound - Organic oxygen compound - Alcohol - Amine - Alkyl halide - Alkyl chloride - Organopnictogen compound - Aliphatic heteromonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitrogen mustard compounds. These are compounds having two beta-haloalkyl groups bound to a nitrogen atom. |
| External Descriptors | Not available |
| Poids moléculaire | 304.160 g/mol |
|---|---|
| XLogP3 | -1.200 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 6 |
| Exact Mass | 303.064 Da |
| Monoisotopic Mass | 303.064 Da |
| Topological Polar Surface Area | 93.400 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 242.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |