Determine the necessary mass, volume, or concentration for preparing a solution.
analytical standard Analytical standard for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 3 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sourires canoniques | C1(C(C(C(C(C1Cl)Cl)Cl)Cl)Cl)Cl |
|---|---|
| IUPAC Name | 1,2,3,4,5,6-hexachlorocyclohexane |
| InChIKey | JLYXXMFPNIAWKQ-UHFFFAOYSA-N |
| INCHI | 1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H |
| Isomères SMILES | C1(C(C(C(C(C1Cl)Cl)Cl)Cl)Cl)Cl |
| WGK Allemagne | 1 |
| Numéro ONU | 2761 |
| Groupe d'emballage | I |
| Poids moléculaire | 290.83 |
| Beilstein | 1907334 |
| Reaxy-Rn | 1907331 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1907331&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Classe | Alkyl halides |
| Subclass | Cyclohexyl halides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cyclohexyl halides |
| Alternative Parents | Organochlorides Hydrocarbon derivatives Alkyl chlorides |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cyclohexyl halide - Hydrocarbon derivative - Organochloride - Alkyl chloride - Aliphatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as cyclohexyl halides. These are organohalogen compounds containing a monocyclic cyclohexane moiety that is substituted at one or more positions by an halogen atom. |
| External Descriptors | a small molecule |
| Point d'éclair (°C) | 11°C |
|---|---|
| Point de fusion (°C) | 136-140°C |
| Poids moléculaire | 290.800 g/mol |
| XLogP3 | 3.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 289.857 Da |
| Monoisotopic Mass | 287.86 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 104.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Xia Zhou, Qian Zhao, Guangqiang Liu, Weiping Cai. (2019) 4-Mercaptophenylboronic acid modified Au nanosheets-built hollow sub-microcubes for active capture and ultrasensitive SERS-based detection of hexachlorocyclohexane pesticides. SENSORS AND ACTUATORS B-CHEMICAL, [PMID:] [10.1016/j.snb.2019.04.153] |
| 2. Mingxue Wu, Gang Chen, Ping Liu, Weihong Zhou, Qiong Jia. (2015) Preparation of porous aromatic framework/ionic liquid hybrid composite coated solid-phase microextraction fibers and their application in the determination of organochlorine pesticides combined with GC-ECD detection. ANALYST, 141 (1): (243-250). [PMID:26579991] [10.1039/C5AN01372K] |
| 3. Dongdong Shi, Guiqin Yan. (2026) Turn-Off Fluorescent Sensor Based on 3-Aminophenylboronic Acid-Modified CdSe/ZnS Quantum Dots for Specific Detection of γ-Hexachlorocyclohexane (Lindane). MOLECULES, 31 (17): (2989). [PMID:] [10.3390/molecules31172989] |
Our grade selection guide covers purity, stabilizer status, and application suitability for all variants in our catalog.
View Analytical standard grade guide →