Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sourires canoniques | CN(C)S(=O)(=O)CCNC(=O)N(CCCl)N=O |
|---|---|
| IUPAC Name | 1-(2-chloroethyl)-3-[2-(dimethylsulfamoyl)ethyl]-1-nitrosourea |
| InChIKey | RCLLNBVPCJDIPX-UHFFFAOYSA-N |
| INCHI | 1S/C7H15ClN4O4S/c1-11(2)17(15,16)6-4-9-7(13)12(10-14)5-3-8/h3-6H2,1-2H3,(H,9,13) |
| Isomères SMILES | CN(C)S(=O)(=O)CCNC(=O)N(CCCl)N=O |
| CAS alternatif | 85977-49-7 |
| PubChem CID | 55456 |
| Numéro NSC | 608678 |
| Termes d'entrée MeSH | 1-(2-chloroethyl)-3-(2-(dimethylaminosulfonyl)ethyl)-1-nitrosourea;tauromustine;TCNU |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Classe | Organic carbonic acids and derivatives |
| Subclass | Ureas |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Nitrosoureas |
| Alternative Parents | Organosulfonamides Organic sulfonamides Semicarbazides Nitrosamides Aminosulfonyl compounds Organopnictogen compounds Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds Alkyl chlorides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Nitrosourea - Organic sulfonic acid amide - Organosulfonic acid amide - Semicarbazide - Organic sulfonic acid or derivatives - Organosulfonic acid or derivatives - Nitrosamide - Aminosulfonyl compound - Sulfonyl - Organic n-nitroso compound - Organic nitroso compound - Alkyl chloride - Hydrocarbon derivative - Organic oxide - Organopnictogen compound - Organic oxygen compound - Organosulfur compound - Organooxygen compound - Organonitrogen compound - Organochloride - Organohalogen compound - Organic nitrogen compound - Carbonyl group - Alkyl halide - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as nitrosoureas. These are compounds containing a nitro group and an urea group N-N linked together, with the general structure R1N(R2)C(=O)N(R3)N=O. |
| External Descriptors | Not available |
| Poids moléculaire | 286.740 g/mol |
|---|---|
| XLogP3 | 0.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 6 |
| Exact Mass | 286.05 Da |
| Monoisotopic Mass | 286.05 Da |
| Topological Polar Surface Area | 108.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 353.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |