Determine the necessary mass, volume, or concentration for preparing a solution.
≥97%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC1(C2CCC1(C(=S)C2)C)C |
|---|---|
| IUPAC Name | (1R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptane-2-thione |
| InChIKey | AAADKYXUTOBAGS-XCBNKYQSSA-N |
| INCHI | 1S/C10H16S/c1-9(2)7-4-5-10(9,3)8(11)6-7/h7H,4-6H2,1-3H3/t7-,10+/m1/s1 |
| Isomeric SMILES | C[C@@]12CC[C@@H](C1(C)C)CC2=S |
| PubChem CID | 1714210 |
| Molecular Weight | 168.3 |
| Beilstein | 7(3)419 |
| Reaxy-Rn | 4230673 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Class | Prenol lipids |
| Subclass | Monoterpenoids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Bicyclic monoterpenoids |
| Alternative Parents | Thioketones Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Bicyclic monoterpenoid - Bornane monoterpenoid - Thioketone - Hydrocarbon derivative - Thiocarbonyl group - Organosulfur compound - Aliphatic homopolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as bicyclic monoterpenoids. These are monoterpenoids containing exactly 2 rings, which are fused to each other. |
| External Descriptors | Not available |
| Specific Rotation[α] | -21° (C=3,EtOAc) |
|---|---|
| Melt Point(°C) | 137 °C |
| Molecular Weight | 168.300 g/mol |
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 168.097 Da |
| Monoisotopic Mass | 168.097 Da |
| Topological Polar Surface Area | 32.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 217.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |