Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 488198000 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/488198000 |
| Sorrisi canonici | C1=CC(=C(C(=C1)Cl)Cl)NN.Cl |
| IUPAC Name | (2,3-dichlorophenyl)hydrazine;hydrochloride |
| InChIKey | RHNATWVYOKUFLK-UHFFFAOYSA-N |
| INCHI | 1S/C6H6Cl2N2.ClH/c7-4-2-1-3-5(10-9)6(4)8;/h1-3,10H,9H2;1H |
| Isomeri SMILES | C1=CC(=C(C(=C1)Cl)Cl)NN.Cl |
| CAS alternativo | 13147-14-3 |
| Peso molecolare | 213.49 |
| Reaxy-Rn | 3708910 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3708910&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Classe | Benzene and substituted derivatives |
| Subclass | Halobenzenes |
| Intermediate Tree Nodes | Chlorobenzenes |
| Direct Parent | Dichlorobenzenes |
| Alternative Parents | Phenylhydrazines Aryl chlorides Organopnictogen compounds Organonitrogen compounds Organochlorides Organic zwitterions Organic chloride salts Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Phenylhydrazine - 1,2-dichlorobenzene - Aryl halide - Aryl chloride - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organic chloride salt - Organic salt - Organic zwitterion - Organonitrogen compound - Organochloride - Organohalogen compound - Aromatic homomonocyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as dichlorobenzenes. These are compounds containing a benzene with exactly two chlorine atoms attached to it. |
| External Descriptors | Not available |
| Sensibilità | Air Sensitive,Hygroscopic |
|---|---|
| Peso molecolare | 213.500 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 211.967 Da |
| Monoisotopic Mass | 211.967 Da |
| Topological Polar Surface Area | 38.100 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 110.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |
| 1. Chunling Ren, Xiao Xu, Dan Yan, Mengzhen Gu, Jinghan Zhang, Haili Zhang, Chao Han, Lingyi Kong. (2022) Dual-action nanoplatform with a synergetic strategy to promote oxygen accumulation for enhanced photodynamic therapy against hypoxic tumors. Acta Biomaterialia, [PMID:35526738] [10.1016/j.actbio.2022.04.035] |
| 2. Dan Chen, Ya-Xian Wu, Yu-bao Qiu, Bin-bin Wan, Gang Liu, Jun-liang Chen, Mu-dan Lu, Qing-feng Pang. (2019) Hyperoside suppresses hypoxia-induced A549 survival and proliferation through ferrous accumulation via AMPK/HO-1 axis. PHYTOMEDICINE, [PMID:31881478] [10.1016/j.phymed.2019.153138] |