Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisi canonici | CCP1(=O)OP(=O)(OP(=O)(O1)CC)CC |
|---|---|
| IUPAC Name | 2,4,6-triethyl-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinane 2,4,6-trioxide |
| InChIKey | KGMOTOPNEPTZJH-UHFFFAOYSA-N |
| INCHI | 1S/C6H15O6P3/c1-4-13(7)10-14(8,5-2)12-15(9,6-3)11-13/h4-6H2,1-3H3 |
| Isomeri SMILES | CCP1(=O)OP(=O)(OP(=O)(O1)CC)CC |
| PubChem CID | 15750749 |
| Peso molecolare | 276.1 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Classe | Organic phosphonic acids and derivatives |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organic phosphonic acids and derivatives |
| Alternative Parents | Oxacyclic compounds Organophosphorus compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Organophosphonic acid derivative - Oxacycle - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organophosphorus compound - Aliphatic heteromonocyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as organic phosphonic acids and derivatives. These are organic compounds containing phosphonic acid or a derivative thereof. |
| External Descriptors | Not available |
| Peso molecolare | 276.100 g/mol |
|---|---|
| XLogP3 | -0.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 3 |
| Exact Mass | 276.008 Da |
| Monoisotopic Mass | 276.008 Da |
| Topological Polar Surface Area | 78.900 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 296.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |