Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(CP),≥98 atom% D for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 528757212 |
|---|---|
| Sorrisi canonici | CC(C)Br |
| IUPAC Name | 2-bromo-1,1,1,3,3,3-hexadeuteriopropane |
| InChIKey | NAMYKGVDVNBCFQ-WFGJKAKNSA-N |
| INCHI | 1S/C3H7Br/c1-3(2)4/h3H,1-2H3/i1D3,2D3 |
| Isomeri SMILES | [2H]C([2H])([2H])C(C([2H])([2H])[2H])Br |
| CAS alternativo | 75-26-3(unlabelled) |
| Numero UN | 2344 |
| Gruppo di imballaggio | II |
| Peso molecolare | 129.03 |
| Reaxy-Rn | 741852 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=741852&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organohalogen compounds |
| Classe | Organobromides |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Organobromides |
| Alternative Parents | Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hydrocarbon derivative - Organobromide - Alkyl halide - Alkyl bromide - Aliphatic acyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as organobromides. These are compounds containing a chemical bond between a carbon atom and a bromine atom. |
| External Descriptors | Not available |
| Peso molecolare | 129.030 g/mol |
|---|---|
| XLogP3 | 1.800 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 0 |
| Exact Mass | 128.011 Da |
| Monoisotopic Mass | 128.011 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 4 |
| Formal Charge | 0 |
| Complexity | 10.800 |
| Isotope Atom Count | 6 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |