Determine the necessary mass, volume, or concentration for preparing a solution.
≥98%(CP),≥98 atom% D for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
o-Toluidine-d7 is a deuterated labeled o-Toluidine (HY-41497). o-Toluidine is widely used to measure glucose levels in blood and body fluids. Glucose and primary aromatic amines can condense in glacial acetic acid to form an equilibrium mixture of sugar amines and corresponding Schiff bases. For example, use glacial acetic acid to prepare 6% o-Toluidine, add it to the solution containing the test, and add trichloroacetic acid to remove protein. After heating at 100°C for 10 minutes and rapidly cooling to room temperature, the absorbance at 630 nm can be measured to calculate the glucose level.
| Canonical Smiles | CC1=CC=CC=C1N |
|---|---|
| IUPAC Name | N,N,2,3,4,5-hexadeuterio-6-(trideuteriomethyl)aniline |
| InChIKey | RNVCVTLRINQCPJ-LLZDZVHOSA-N |
| INCHI | 1S/C7H9N/c1-6-4-2-3-5-7(6)8/h2-5H,8H2,1H3/i1D3,2D,3D,4D,5D/hD2 |
| Isomeric SMILES | [2H]C1=C(C(=C(C(=C1[2H])C([2H])([2H])[2H])N([2H])[2H])[2H])[2H] |
| Alternate CAS | 95-53-4(unlabelled) |
| Molecular Weight | 114.20 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Class | Benzene and substituted derivatives |
| Subclass | Toluenes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Toluenes |
| Alternative Parents | Primary amines Hydrocarbon derivatives |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Toluene - Organic nitrogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Amine - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as toluenes. These are compounds containing a benzene ring which bears a methane group. |
| External Descriptors | Not available |
| Solubility | Soluble in Chloroform |
|---|---|
| Molecular Weight | 116.210 g/mol |
| XLogP3 | 1.300 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 0 |
| Exact Mass | 116.13 Da |
| Monoisotopic Mass | 116.13 Da |
| Topological Polar Surface Area | 26.000 Ų |
| Heavy Atom Count | 8 |
| Formal Charge | 0 |
| Complexity | 70.800 |
| Isotope Atom Count | 9 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |