| Pubchem Sid | 504764626 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504764626 |
| Canonical Smiles | CC(=O)NC(CCC(=O)O)C(=O)N |
| IUPAC Name | (4S)-4-acetamido-5-amino-5-oxopentanoic acid |
| InChIKey | ZAFUMUJQGCBVPX-YFKPBYRVSA-N |
| INCHI | 1S/C7H12N2O4/c1-4(10)9-5(7(8)13)2-3-6(11)12/h5H,2-3H2,1H3,(H2,8,13)(H,9,10)(H,11,12)/t5-/m0/s1 |
| Isomeric SMILES | CC(=O)N[C@@H](CCC(=O)O)C(=O)N |
| Molecular Weight | 188.18 |
| Reaxy-Rn | 54279092 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=54279092&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Class | Carboxylic acids and derivatives |
| Subclass | Amino acids, peptides, and analogues |
| Intermediate Tree Nodes | Amino acids and derivatives - Alpha amino acids and derivatives |
| Direct Parent | Glutamic acid and derivatives |
| Alternative Parents | N-acyl-alpha amino acids and derivatives Fatty amides Fatty acids and conjugates Acetamides Secondary carboxylic acid amides Primary carboxylic acid amides Monocarboxylic acids and derivatives Carboxylic acids Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Glutamic acid or derivatives - N-acyl-alpha amino acid or derivatives - Fatty amide - Fatty acid - Fatty acyl - Acetamide - Secondary carboxylic acid amide - Primary carboxylic acid amide - Carboxamide group - Monocarboxylic acid or derivatives - Carboxylic acid - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Organic nitrogen compound - Carbonyl group - Aliphatic acyclic compound |
| Description | This compound belongs to the class of organic compounds known as glutamic acid and derivatives. These are compounds containing glutamic acid or a derivative thereof resulting from reaction of glutamic acid at the amino group or the carboxy group, or from the replacement of any hydrogen of glycine by a heteroatom. |
| External Descriptors | Not available |
Find and download the COA for your product by matching the lot number on the packaging.
| Lot Number | Certificate Type | Date | Item |
|---|---|---|---|
 A2628042 | Certificate of Analysis | Feb 03, 2026 | A354425 |
| K2212029 | Certificate of Analysis | Aug 12, 2025 | A354425 |
| K2212030 | Certificate of Analysis | Aug 12, 2025 | A354425 |
| K2212051 | Certificate of Analysis | Aug 12, 2025 | A354425 |
| Molecular Weight | 188.180 g/mol |
|---|---|
| XLogP3 | -2.500 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 188.08 Da |
| Monoisotopic Mass | 188.08 Da |
| Topological Polar Surface Area | 109.000 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 227.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
