Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisi canonici | C(CCN)CC(C(=O)O)NC(=O)CC(C(=O)O)N |
|---|---|
| IUPAC Name | (2S)-6-amino-2-[[(3S)-3-amino-3-carboxypropanoyl]amino]hexanoic acid |
| InChIKey | QGNYWQOMJSTUQZ-BQBZGAKWSA-N |
| INCHI | 1S/C10H19N3O5/c11-4-2-1-3-7(10(17)18)13-8(14)5-6(12)9(15)16/h6-7H,1-5,11-12H2,(H,13,14)(H,15,16)(H,17,18)/t6-,7-/m0/s1 |
| Isomeri SMILES | C(CCN)C[C@@H](C(=O)O)NC(=O)C[C@@H](C(=O)O)N |
| PubChem CID | 165361 |
| Peso molecolare | 261.28 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Classe | Peptidomimetics |
| Subclass | Hybrid peptides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Hybrid peptides |
| Alternative Parents | Asparagine and derivatives N-acyl-L-alpha-amino acids L-alpha-amino acids Medium-chain fatty acids Amino fatty acids N-acyl amines Dicarboxylic acids and derivatives Secondary carboxylic acid amides Amino acids Carboxylic acids Organopnictogen compounds Organic oxides Monoalkylamines Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Hybrid peptide - Asparagine or derivatives - N-acyl-alpha-amino acid - N-acyl-alpha amino acid or derivatives - N-acyl-l-alpha-amino acid - Alpha-amino acid - Alpha-amino acid or derivatives - L-alpha-amino acid - Medium-chain fatty acid - Amino fatty acid - Fatty acyl - Fatty acid - N-acyl-amine - Dicarboxylic acid or derivatives - Fatty amide - Amino acid - Secondary carboxylic acid amide - Amino acid or derivatives - Carboxamide group - Carboxylic acid derivative - Carboxylic acid - Hydrocarbon derivative - Organic nitrogen compound - Primary aliphatic amine - Organic oxygen compound - Organopnictogen compound - Organonitrogen compound - Carbonyl group - Organooxygen compound - Primary amine - Amine - Organic oxide - Aliphatic acyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as hybrid peptides. These are compounds containing at least two different types of amino acids (alpha, beta, gamma, delta) linked to each other through a peptide bond. |
| External Descriptors | Not available |
| Peso molecolare | 261.279 g/mol |
|---|---|
| XLogP3 | -6.600 |
| Hydrogen Bond Donor Count | 5 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 9 |
| Exact Mass | 261.132 Da |
| Monoisotopic Mass | 261.132 Da |
| Topological Polar Surface Area | 156.000 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 308.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |