Determine the necessary mass, volume, or concentration for preparing a solution.
≥99% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Protected from light,Store at -20°C Ships Ice chest + Ice pads Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisi canonici | COC1=CC(=C2C(=C1)C=CC3=CC(=C(C=C32)O)OC)OC |
|---|---|
| IUPAC Name | 2,5,7-trimethoxyphenanthren-3-ol |
| InChIKey | KGYHMWVRKYFQQR-UHFFFAOYSA-N |
| INCHI | 1S/C17H16O4/c1-19-12-6-11-5-4-10-7-15(20-2)14(18)9-13(10)17(11)16(8-12)21-3/h4-9,18H,1-3H3 |
| Isomeri SMILES | COC1=CC(=C2C(=C1)C=CC3=CC(=C(C=C32)O)OC)OC |
| PubChem CID | 442694 |
| Peso molecolare | 284.31 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Classe | Phenanthrenes and derivatives |
| Subclass | Phenanthrols |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Phenanthrols |
| Alternative Parents | Naphthols and derivatives Anisoles Alkyl aryl ethers 1-hydroxy-2-unsubstituted benzenoids Hydrocarbon derivatives |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Phenanthrol - 2-naphthol - Naphthalene - Anisole - 1-hydroxy-2-unsubstituted benzenoid - Alkyl aryl ether - Ether - Organic oxygen compound - Hydrocarbon derivative - Organooxygen compound - Aromatic homopolycyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as phenanthrols. These are compounds containing a phenanthrene (or its hydrogenated derivative) to which a hydroxyl group is attached. |
| External Descriptors | phenanthrenes |
| Sensibilità | light sensitive |
|---|---|
| Peso molecolare | 284.310 g/mol |
| XLogP3 | 4.000 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 284.105 Da |
| Monoisotopic Mass | 284.105 Da |
| Topological Polar Surface Area | 47.900 Ų |
| Heavy Atom Count | 21 |
| Formal Charge | 0 |
| Complexity | 348.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |