Determine the necessary mass, volume, or concentration for preparing a solution.
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 528764063 |
|---|---|
| Sorrisi canonici | C(=O)C(C1C(C(C(=O)O1)O)O)O |
| IUPAC Name | (2R)-2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxyacetaldehyde |
| InChIKey | UYUXSRADSPPKRZ-SKNVOMKLSA-N |
| INCHI | 1S/C6H8O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h1-5,8-10H/t2-,3+,4-,5+/m0/s1 |
| Isomeri SMILES | C(=O)[C@@H]([C@@H]1[C@@H]([C@@H](C(=O)O1)O)O)O |
| WGK Germania | 2 |
| RTECS | LZ8930000 |
| Peso molecolare | 176.12 |
| Beilstein | 83595 |
| Reaxy-Rn | 102193 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=102193&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Classe | Lactones |
| Subclass | Gamma butyrolactones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Gamma butyrolactones |
| Alternative Parents | Tetrahydrofurans Alpha-hydroxyaldehydes Secondary alcohols Carboxylic acid esters Oxacyclic compounds Monocarboxylic acids and derivatives Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Gamma butyrolactone - Tetrahydrofuran - Alpha-hydroxyaldehyde - Carboxylic acid ester - Secondary alcohol - Carboxylic acid derivative - Monocarboxylic acid or derivatives - Oxacycle - Aldehyde - Organic oxide - Organic oxygen compound - Alcohol - Carbonyl group - Organooxygen compound - Hydrocarbon derivative - Aliphatic heteromonocyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as gamma butyrolactones. These are compounds containing a gamma butyrolactone moiety, which consists of an aliphatic five-member ring with four carbon atoms, one oxygen atom, and bears a ketone group on the carbon adjacent to the oxygen atom. |
| External Descriptors | glucuronolactone |
| Rotazione specifica [α] | 18.5 ° (C=5, H2O) |
|---|---|
| Punto di fusione (°C) | 170-176°C |
| Peso molecolare | 176.120 g/mol |
| XLogP3 | -1.800 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 176.032 Da |
| Monoisotopic Mass | 176.032 Da |
| Topological Polar Surface Area | 104.000 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 202.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Lu Han, Wenyi Huang, Lingyun Meng, Xinyi Duan, Yufei Wu, Qihui Lin, Xiaohua Wu, Qi Chen, Wanhua Shen. (2025) Oxidative stress-mediated neurotoxicity of para-xylene and neuroprotection by gluconolactone in Xenopus laevis. ENVIRONMENTAL POLLUTION, [PMID:40602637] [10.1016/j.envpol.2025.126756] |