Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| pKa | pKa: 11.38 (Predicted) |
|---|
| Sorrisi canonici | C(C(C(C(C(C(=O)CO)O)O)O)O)O |
|---|---|
| IUPAC Name | (3S,4S,5R,6R)-1,3,4,5,6,7-hexahydroxyheptan-2-one |
| InChIKey | HSNZZMHEPUFJNZ-QMTIVRBISA-N |
| INCHI | 1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h3,5-10,12-14H,1-2H2/t3-,5-,6-,7+/m1/s1 |
| Isomeri SMILES | C([C@H]([C@H]([C@@H]([C@@H](C(=O)CO)O)O)O)O)O |
| WGK Germania | 2 |
| PubChem CID | 12600 |
| Peso molecolare | 210.18 |
| Beilstein | 1726433 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Classe | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Monosaccharides |
| Direct Parent | Heptoses |
| Alternative Parents | Beta-hydroxy ketones Acyloins Alpha-hydroxy ketones Secondary alcohols Polyols Primary alcohols Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Heptose monosaccharide - Beta-hydroxy ketone - Acyloin - Alpha-hydroxy ketone - Secondary alcohol - Ketone - Polyol - Organic oxide - Hydrocarbon derivative - Primary alcohol - Carbonyl group - Alcohol - Aliphatic acyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as heptoses. These are monosaccharides in which the sugar unit is a seven-carbon containing moeity. |
| External Descriptors | D-manno-heptulose |
| Indice di rifrazione | n20D1.64 (Predicted) |
|---|---|
| Punto di ebollizione (°C) | ~471.7° C at 760 mmHg (Predicted) |
| Punto di fusione (°C) | 148-150° C |
| Peso molecolare | 210.180 g/mol |
| XLogP3 | -3.900 |
| Hydrogen Bond Donor Count | 6 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 6 |
| Exact Mass | 210.074 Da |
| Monoisotopic Mass | 210.074 Da |
| Topological Polar Surface Area | 138.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 183.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |