Determine the necessary mass, volume, or concentration for preparing a solution.
≥95%(GC) for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Argon charged,Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 504755623 |
|---|---|
| Pubchem Sid Url | https://pubchem.ncbi.nlm.nih.gov/substance/504755623 |
| Canonical Smiles | C=CC[Si](CC=C)(C1=CC=CC=C1)C2=CC=CC=C2 |
| IUPAC Name | diphenyl-bis(prop-2-enyl)silane |
| InChIKey | ZODWTWYKYYGSFS-UHFFFAOYSA-N |
| INCHI | 1S/C18H20Si/c1-3-15-19(16-4-2,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h3-14H,1-2,15-16H2 |
| Isomeric SMILES | C=CC[Si](CC=C)(C1=CC=CC=C1)C2=CC=CC=C2 |
| Molecular Weight | 264.44 |
| Beilstein | 16(4)1369 |
| Reaxy-Rn | 2938997 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2938997&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Class | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkylarylsilanes |
| Alternative Parents | Benzene and substituted derivatives Hydrocarbon derivatives Alkylsilanes |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Alkylarylsilane - Benzenoid - Monocyclic benzene moiety - Hydrocarbon derivative - Alkylsilane - Aromatic homomonocyclic compound |
| Description | This compound belongs to the class of organic compounds known as alkylarylsilanes. These are organosilicon compounds with the general formula R[Si]R' (R = alkyl, R' = aryl). |
| External Descriptors | Not available |
| Sensitivity | Moisture sensitive |
|---|---|
| Refractive Index | 1.58 |
| Boil Point(°C) | 141°C/2mmHg(lit.) |
| Molecular Weight | 264.400 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 0 |
| Rotatable Bond Count | 6 |
| Exact Mass | 264.133 Da |
| Monoisotopic Mass | 264.133 Da |
| Topological Polar Surface Area | 0.000 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 252.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |