Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisi canonici | COC1CC23C(=CCN2CCC4=CC5=C(C=C34)OCO5)C=C1 |
|---|---|
| IUPAC Name | (1S,19R)-19-methoxy-5,7-dioxa-13-azapentacyclo[11.7.0.01,16.02,10.04,8]icosa-2,4(8),9,15,17-pentaene |
| InChIKey | TVOFUERNMZTYRM-KSSFIOAISA-N |
| INCHI | 1S/C18H19NO3/c1-20-14-3-2-13-5-7-19-6-4-12-8-16-17(22-11-21-16)9-15(12)18(13,19)10-14/h2-3,5,8-9,14H,4,6-7,10-11H2,1H3/t14-,18-/m0/s1 |
| Isomeri SMILES | CO[C@@H]1C[C@@]23C(=CCN2CCC4=CC5=C(C=C34)OCO5)C=C1 |
| PubChem CID | 5317205 |
| Peso molecolare | 297.35 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Alkaloids and derivatives |
| Classe | Erythrina alkaloids |
| Subclass | Erythrinanes |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Erythrinanes |
| Alternative Parents | Tetrahydroisoquinolines Indoles and derivatives Benzodioxoles Aralkylamines Benzenoids Pyrrolines Trialkylamines Oxacyclic compounds Dialkyl ethers Azacyclic compounds Acetals Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Erythrinane skeleton - Tetrahydroisoquinoline - Benzodioxole - Indole or derivatives - Aralkylamine - Benzenoid - Pyrroline - Tertiary amine - Tertiary aliphatic amine - Oxacycle - Dialkyl ether - Ether - Azacycle - Acetal - Organoheterocyclic compound - Organopnictogen compound - Organonitrogen compound - Organooxygen compound - Organic nitrogen compound - Amine - Hydrocarbon derivative - Organic oxygen compound - Aromatic heteropolycyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as erythrinanes. These are erythrina alkaloids possessing either a 6-5-6-6-membered indoloisoquinoline core or a derivative thereof. |
| External Descriptors | Not available |
| Peso molecolare | 297.300 g/mol |
|---|---|
| XLogP3 | 2.000 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 1 |
| Exact Mass | 297.136 Da |
| Monoisotopic Mass | 297.136 Da |
| Topological Polar Surface Area | 30.900 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 530.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 2 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |