Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisi canonici | CC1(COC(C(C1NC)O)OC2C(CC(C(C2O)O)N)N)O |
|---|---|
| IUPAC Name | (2R,3R,4R,5R)-2-[(1S,2S,3R,4S,6R)-4,6-diamino-2,3-dihydroxycyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol |
| InChIKey | ONKJLIUSEXIAKL-QUDADGMASA-N |
| INCHI | 1S/C13H27N3O6/c1-13(20)4-21-12(9(19)11(13)16-2)22-10-6(15)3-5(14)7(17)8(10)18/h5-12,16-20H,3-4,14-15H2,1-2H3/t5-,6+,7+,8-,9+,10-,11+,12+,13-/m0/s1 |
| Isomeri SMILES | C[C@@]1(CO[C@@H]([C@@H]([C@H]1NC)O)O[C@H]2[C@@H](C[C@@H]([C@H]([C@@H]2O)O)N)N)O |
| PubChem CID | 14699895 |
| Peso molecolare | 501.52 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Classe | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Aminosaccharides - Aminoglycosides |
| Direct Parent | Aminocyclitol glycosides |
| Alternative Parents | O-glycosyl compounds Pentoses Aminocyclitols and derivatives Cyclohexylamines Cyclohexanols Oxanes Tertiary alcohols 1,2-aminoalcohols Oxacyclic compounds Dialkylamines Acetals Organopnictogen compounds Monoalkylamines Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | Amino cyclitol glycoside - O-glycosyl compound - Glycosyl compound - Pentose monosaccharide - Aminocyclitol or derivatives - Cyclohexylamine - Cyclohexanol - Oxane - Monosaccharide - Cyclitol or derivatives - Tertiary alcohol - Cyclic alcohol - Secondary alcohol - 1,2-aminoalcohol - Oxacycle - Organoheterocyclic compound - Secondary amine - Secondary aliphatic amine - Acetal - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Primary aliphatic amine - Amine - Alcohol - Aliphatic heteromonocyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as aminocyclitol glycosides. These are organic compounds containing an amicocyclitol moiety glycosidically linked to a carbohydrate moiety. There are two major classes of aminoglycosides containing a 2-streptamine core. They are called 4,5- and 4,6-disubstituted 2-deoxystreptamines. |
| External Descriptors | Not available |
| Peso molecolare | 321.370 g/mol |
|---|---|
| XLogP3 | -4.300 |
| Hydrogen Bond Donor Count | 7 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 3 |
| Exact Mass | 321.19 Da |
| Monoisotopic Mass | 321.19 Da |
| Topological Polar Surface Area | 163.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 389.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 9 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |