Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisi canonici | C(C1C(C(C(O1)N2C3=C(C(=O)NC(=N3)N)SC2=O)O)O)O.O |
|---|---|
| IUPAC Name | 5-amino-3-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione;hydrate |
| InChIKey | BZWQQOVSUSJJJO-QAGDRQIHSA-N |
| INCHI | 1S/C10H12N4O6S.H2O/c11-9-12-6-5(7(18)13-9)21-10(19)14(6)8-4(17)3(16)2(1-15)20-8;/h2-4,8,15-17H,1H2,(H3,11,12,13,18);1H2/t2-,3-,4-,8-;/m1./s1 |
| Isomeri SMILES | C([C@@H]1[C@H]([C@H]([C@@H](O1)N2C3=C(C(=O)NC(=N3)N)SC2=O)O)O)O.O |
| CAS alternativo | 1108170-71-3,198832-38-1 |
| PubChem CID | 135484549 |
| Termini MeSH | 5-amino-3-beta-D-ribofuranosylthiazolo(4,5-d)pyrimidine- 2,7(3H,6H)-dione monohydrate;5-amino-3-ribofuranosylthiazolo(4,5-d)pyrimidine-2,7(3H,6H)-dione;7-deaza-7-thia-8-oxoguanosine;7-thia-8-oxoguanosine;ICN-10146;Immusine;isatoribine;isatoribine anhydrou |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Classe | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Glycosyl compounds |
| Direct Parent | Glycosylamines |
| Alternative Parents | Pentoses Pyrimidones Aminopyrimidines and derivatives Vinylogous amides Thiazoles Tetrahydrofurans Heteroaromatic compounds Secondary alcohols Oxacyclic compounds Azacyclic compounds Primary amines Primary alcohols Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | N-glycosyl compound - Pentose monosaccharide - Aminopyrimidine - Pyrimidone - Monosaccharide - Pyrimidine - Heteroaromatic compound - Azole - Vinylogous amide - Thiazole - Tetrahydrofuran - Secondary alcohol - Organoheterocyclic compound - Oxacycle - Azacycle - Hydrocarbon derivative - Amine - Primary amine - Primary alcohol - Organic oxide - Organonitrogen compound - Alcohol - Organopnictogen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as glycosylamines. These are compounds consisting of an amine with a beta-N-glycosidic bond to a carbohydrate, thus forming a cyclic hemiaminal ether bond (alpha-amino ether). |
| External Descriptors | Not available |
| Peso molecolare | 334.310 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 6 |
| Hydrogen Bond Acceptor Count | 9 |
| Rotatable Bond Count | 2 |
| Exact Mass | 334.058 Da |
| Monoisotopic Mass | 334.058 Da |
| Topological Polar Surface Area | 184.000 Ų |
| Heavy Atom Count | 22 |
| Formal Charge | 0 |
| Complexity | 578.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |