Determine the necessary mass, volume, or concentration for preparing a solution.
7500 for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Conservare a 2-8°C, con carica di argon Ships Ghiaccio umido Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 508816176 |
|---|---|
| Sorrisi canonici | C(COCCOCCN=[N+]=[N-])N=[N+]=[N-] |
| IUPAC Name | 1-azido-2-[2-(2-azidoethoxy)ethoxy]ethane |
| InChIKey | OHZGAFKSAANFAS-UHFFFAOYSA-N |
| INCHI | 1S/C6H12N6O2/c7-11-9-1-3-13-5-6-14-4-2-10-12-8/h1-6H2 |
| Isomeri SMILES | C(COCCOCCN=[N+]=[N-])N=[N+]=[N-] |
| WGK Germania | 3 |
| Reaxy-Rn | 1911368 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=1911368&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic 1,3-dipolar compounds |
| Classe | Allyl-type 1,3-dipolar organic compounds |
| Subclass | Azo imides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azo imides |
| Alternative Parents | Azo compounds Dialkyl ethers Organic salts Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Azo imide - Azo compound - Ether - Dialkyl ether - Organic nitrogen compound - Organic oxygen compound - Hydrocarbon derivative - Organic salt - Organooxygen compound - Organonitrogen compound - Organic cation - Aliphatic acyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as azo imides. These are n-Imides of azo compounds, analogous to azoxy compounds, having a delocalized structure. |
| External Descriptors | Not available |
| Sensibilità | Hygroscopic |
|---|---|
| Punto di infiammabilità (°C) | >110°C |
| Peso molecolare | 200.200 g/mol |
| XLogP3 | 1.700 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 9 |
| Exact Mass | 200.102 Da |
| Monoisotopic Mass | 200.102 Da |
| Topological Polar Surface Area | 47.200 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 196.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |