Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisi canonici | CC(C(C1=CN=C2C(=N1)C(=O)NC(=N2)N)O)O |
|---|---|
| IUPAC Name | 2-amino-6-(1,2-dihydroxypropyl)-3H-pteridin-4-one |
| InChIKey | LHQIJBMDNUYRAM-UHFFFAOYSA-N |
| INCHI | 1S/C9H11N5O3/c1-3(15)6(16)4-2-11-7-5(12-4)8(17)14-9(10)13-7/h2-3,6,15-16H,1H3,(H3,10,11,13,14,17) |
| Isomeri SMILES | CC(C(C1=CN=C2C(=N1)C(=O)NC(=N2)N)O)O |
| CAS alternativo | 36183-24-1,22150-76-1 |
| PubChem CID | 135398729 |
| Termini MeSH | 2-Amino-6-(1,2-dihydroxypropyl)-4(1H)-pteridinone;Biopterin;Dictyopterin;Orinapterin |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Classe | Pteridines and derivatives |
| Subclass | Pterins and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Biopterins and derivatives |
| Alternative Parents | Hydroxypyrimidines Pyrazines Heteroaromatic compounds Secondary alcohols 1,2-diols Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Biopterin - Hydroxypyrimidine - Pyrazine - Pyrimidine - Heteroaromatic compound - 1,2-diol - Secondary alcohol - Azacycle - Organic nitrogen compound - Aromatic alcohol - Hydrocarbon derivative - Organopnictogen compound - Organooxygen compound - Organonitrogen compound - Organic oxygen compound - Alcohol - Aromatic heteropolycyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as biopterins and derivatives. These are coenzymes containing a 2-amino-pteridine-4-one derivative. They are mainly synthesized in several parts of the body, including the pineal gland. |
| External Descriptors | a biopterin |
| Peso molecolare | 237.220 g/mol |
|---|---|
| XLogP3 | -2.400 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 2 |
| Exact Mass | 237.086 Da |
| Monoisotopic Mass | 237.086 Da |
| Topological Polar Surface Area | 134.000 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 348.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |