Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisi canonici | C1=C(C=C(C(=C(C1=O)O)O)O)C(=O)O |
|---|---|
| IUPAC Name | 4,5,6-trihydroxy-3-oxocyclohepta-1,4,6-triene-1-carboxylic acid |
| InChIKey | RRDGXYZZWSIADF-UHFFFAOYSA-N |
| INCHI | 1S/C8H6O6/c9-4-1-3(8(13)14)2-5(10)7(12)6(4)11/h1-2H,(H,13,14)(H3,9,10,11,12) |
| Peso molecolare | 198.13 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Hydrocarbon derivatives |
| Classe | Tropones |
| Subclass | Tropolones |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Tropolones |
| Alternative Parents | Vinylogous acids Cyclic ketones Polyols Monocarboxylic acids and derivatives Carboxylic acids Organic oxides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Tropolone - Vinylogous acid - Cyclic ketone - Polyol - Monocarboxylic acid or derivatives - Carboxylic acid - Carboxylic acid derivative - Organic oxygen compound - Organic oxide - Organooxygen compound - Aromatic homomonocyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as tropolones. These are compounds containing tropone ring with a hydroxyl group at ring position 2. |
| External Descriptors | Not available |
| Peso molecolare | 198.130 g/mol |
|---|---|
| XLogP3 | -0.600 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 1 |
| Exact Mass | 198.016 Da |
| Monoisotopic Mass | 198.016 Da |
| Topological Polar Surface Area | 115.000 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 398.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |