10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
GRK6 inhibitor; SUMOylation inhibitor;
| ALogP | 3.006 |
|---|---|
| Conteggio HBD | 1 |
| Legame rotabile | 3 |
| Pubchem Sid | 528767885 |
|---|---|
| Sorrisi canonici | CCCCN1C(=C(C2=NC3=CC=CC=C3N=C21)C#N)N |
| IUPAC Name | 2-amino-1-butylpyrrolo[3,2-b]quinoxaline-3-carbonitrile |
| InChIKey | OLICCRYPRZAUNK-UHFFFAOYSA-N |
| INCHI | 1S/C15H15N5/c1-2-3-8-20-14(17)10(9-16)13-15(20)19-12-7-5-4-6-11(12)18-13/h4-7H,2-3,8,17H2,1H3 |
| Isomeri SMILES | CCCCN1C(=C(C2=NC3=CC=CC=C3N=C21)C#N)N |
| PubChem CID | 1666392 |
| Peso molecolare | 265.3131 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Classe | Diazanaphthalenes |
| Subclass | Benzodiazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Quinoxalines |
| Alternative Parents | Pyrrolopyrazines Substituted pyrroles Pyrazines Benzenoids Heteroaromatic compounds Nitriles Azacyclic compounds Primary amines Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Quinoxaline - Pyrrolopyrazine - Pyrazine - Benzenoid - Substituted pyrrole - Pyrrole - Heteroaromatic compound - Carbonitrile - Nitrile - Azacycle - Organic nitrogen compound - Primary amine - Organonitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Amine - Aromatic heteropolycyclic compound |
| Descrizione | This compound belongs to the class of organic compounds known as quinoxalines. These are compounds containing a quinoxaline moiety, a bicyclic heterocycle made up of a benzene ring fused to a pyrazine ring. |
| External Descriptors | Not available |
| Activity Type | Relation | Activity value | Units | Action Type | Journal | PubMed Id | doi | Assay Aladdin ID |
|---|
| DMSO (mM) Solubilità massima | 10 |
|---|---|
| Peso molecolare | 265.310 g/mol |
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 265.133 Da |
| Monoisotopic Mass | 265.133 Da |
| Topological Polar Surface Area | 80.500 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 389.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
