Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisos canónicos | CCO[Si](CCCNC(=O)C(=C)C)(OCC)OCC |
|---|---|
| IUPAC Name | 2-methyl-N-(3-triethoxysilylpropyl)prop-2-enamide |
| InChIKey | VJISAEASWJKEQR-UHFFFAOYSA-N |
| INCHI | 1S/C13H27NO4Si/c1-6-16-19(17-7-2,18-8-3)11-9-10-14-13(15)12(4)5/h4,6-11H2,1-3,5H3,(H,14,15) |
| SMILES isoméricas | CCO[Si](CCCNC(=O)C(=C)C)(OCC)OCC |
| PubChem CID | 9857164 |
| Peso molecular | 289.44 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organometallic compounds |
| Classe | Organometalloid compounds |
| Subclass | Organosilicon compounds |
| Intermediate Tree Nodes | Alkoxysilanes |
| Direct Parent | Trialkoxysilanes |
| Alternative Parents | Silyl ethers Secondary carboxylic acid amides Organoheterosilanes Organic metalloid salts Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Trialkoxysilane - Silyl ether - Secondary carboxylic acid amide - Carboxamide group - Organoheterosilane - Organic metalloid salt - Carboxylic acid derivative - Organic nitrogen compound - Organic oxygen compound - Organic oxide - Hydrocarbon derivative - Organooxygen compound - Organonitrogen compound - Carbonyl group - Aliphatic acyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as trialkoxysilanes. These are organosilicon compounds with the general formula RO[Si](R')(OR'')OR''' (R-R''' = aliphatic organyl group). |
| External Descriptors | Not available |
| Peso molecular | 289.440 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 11 |
| Exact Mass | 289.171 Da |
| Monoisotopic Mass | 289.171 Da |
| Topological Polar Surface Area | 56.800 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 267.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |