Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisos canónicos | C1C2CNCC1C3=CC=CC(=O)N3C2 |
|---|---|
| IUPAC Name | 7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| InChIKey | ANJTVLIZGCUXLD-UHFFFAOYSA-N |
| INCHI | 1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2 |
| SMILES isoméricas | C1C2CNCC1C3=CC=CC(=O)N3C2 |
| PubChem CID | 22407 |
| Peso molecular | 190.25 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Alkaloids and derivatives |
| Classe | Lupin alkaloids |
| Subclass | Cytisine and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Cytisine and derivatives |
| Alternative Parents | Pyridinones Aralkylamines Piperidines Heteroaromatic compounds Lactams Dialkylamines Azacyclic compounds Organopnictogen compounds Organooxygen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Cytisine - Aralkylamine - Pyridinone - Piperidine - Pyridine - Heteroaromatic compound - Lactam - Secondary aliphatic amine - Azacycle - Organoheterocyclic compound - Secondary amine - Amine - Hydrocarbon derivative - Organic oxide - Organooxygen compound - Organonitrogen compound - Organopnictogen compound - Organic oxygen compound - Organic nitrogen compound - Aromatic heteropolycyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as cytisine and derivatives. These are lupin alkaloids with a structure based on the cytisine skeleton, which is a tetracyclic ketone containing fused pyridine and piperidine rings that form pyrido[1,2a][1,5]diazocin-8-one. |
| External Descriptors | Quinolizidine alkaloids |
| Ponto de ebulição (°C) | 413 |
|---|---|
| Ponto de fusão (°C) | 154-156 |
| Peso molecular | 190.240 g/mol |
| XLogP3 | 0.200 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 190.111 Da |
| Monoisotopic Mass | 190.111 Da |
| Topological Polar Surface Area | 32.299 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 332.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 2 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |