MMV1802063

ID: ALA5316215

Max Phase: Preclinical

Molecular Formula: C35H42ClN5O8

Molecular Weight: 575.07

This compound is not in our inventory system

Associated Items:

Nomes e identificadores

Canonical SMILES:  C[C@]1(c2ccc(Cl)cn2)Oc2cccc(C3CCN(Cc4nc5ccc(C(=O)O)cc5n4C[C@@H]4CCO4)CC3)c2O1.NC(CO)(CO)CO

Standard InChI:  InChI=1S/C31H31ClN4O5.C4H11NO3/c1-31(27-8-6-21(32)16-33-27)40-26-4-2-3-23(29(26)41-31)19-9-12-35(13-10-19)18-28-34-24-7-5-20(30(37)38)15-25(24)36(28)17-22-11-14-39-22;5-4(1-6,2-7)3-8/h2-8,15-16,19,22H,9-14,17-18H2,1H3,(H,37,38);6-8H,1-3,5H2/t22-,31-;/m0./s1

Standard InChI Key:  UEEOYBOWXLQOLU-ZKXIHYOGSA-N

Molfile:  

     RDKit          2D

 49 54  0  0  0  0  0  0  0  0999 V2000
    4.1221    2.2465    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8186    1.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3311    0.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0275    0.0658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5401   -0.5807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.0159    0.3727    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7567    0.7357    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9934    1.4749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9444   -1.4651    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6588   -1.8776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6588   -2.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9444   -3.1151    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2299   -2.7026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2299   -1.8776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2299   -0.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9444   -0.6400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9444    1.0100    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6588    0.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6588   -0.2275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2299    0.5975    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5033    1.8569    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9444    1.8350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9072    2.4273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2299    2.2475    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0830    3.0593    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2656    3.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4453   -2.9575    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9604   -2.2901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4453   -1.6227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8829    2.7541    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4548    3.4594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6534    3.6554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0845    2.3661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3799    3.0480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0216    3.7911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8011    3.8523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4860    4.4730    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1277    5.2161    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3088    4.4117    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3724   -3.5925    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2904   -2.7715    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2976   -4.0739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0495   -3.7344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1314   -2.9135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4615   -2.4321    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1600    3.8875    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5881    3.1822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2904   -1.8087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7195   -4.2159    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  6  7  1  0
  3  6  1  0
  3  8  1  0
  9 10  2  0
 10 11  1  0
 11 12  2  0
 12 13  1  0
 13 14  2  0
  9 14  1  0
 15 16  1  0
 16  9  1  0
 17 18  1  0
 18 19  1  0
 17 20  1  0
 19 16  1  0
 15 20  1  0
 21 23  1  0
 22 17  1  0
 24 25  1  0
 25 26  1  0
 21 24  2  0
 23 26  2  0
 27 28  1  0
 28 29  1  0
 13 27  1  0
 14 29  1  0
 30 31  1  0
 31 32  1  1
 33 34  2  0
 34 35  1  0
 35 36  2  0
 23 33  1  0
 26 36  1  0
 37 38  2  0
 35 37  1  0
 37 39  1  0
 40 41  1  0
 28 41  1  1
 42 43  1  0
 43 44  2  0
 44 45  1  0
 40 42  2  0
 41 45  2  0
 46 47  1  0
 31 46  1  0
 30 47  1  0
 28 48  1  0
 43 49  1  0
 32 25  1  0
 24 22  1  0
M  END

Alvos associados (não humanos)

Plasmodium falciparum (966862 Activities)
Activity TypeRelationActivity valueUnitsAction TypeJournalPubMed IddoiAssay Aladdin ID

Molecule Features

Natural Product: NoOral: NoChemical Probe: NoParenteral: No
Molecule Type: Topical: NoFirst In Class: NoBlack Box: No
Chirality: NoDisponibilidade: NoProdrug: No

Drug Indications

MESH IDMESH Heading EFO IDsEFO TermsMax Phase for IndicationReferências

Mecanismos de ação

Mechanism of ActionAction Typetarget IDTarget NameTarget TypeTarget OrganismBinding Site NameReferências

Calculated Properties

Molecular Weight: 575.07Molecular Weight (Monoisotopic): 574.1983AlogP: 5.60#Rotatable Bonds: 7
Polar Surface Area: 98.94Molecular Species: ACIDHBA: 8HBD: 1
#RO5 Violations: 2HBA (Lipinski): 9HBD (Lipinski): 1#RO5 Violations (Lipinski): 2
CX Acidic pKa: 3.57CX Basic pKa: 7.07CX LogP: 2.26CX LogD: 1.88
Aromatic Rings: 4Heavy Atoms: 41QED Weighted: 0.30Np Likeness Score: -0.86

Referências

1. Bosc N, Felix E, Gardner JMF, Mills J, Timmerman M, Asveld D, Rensen K, Mukherjee P, Das R, Chenu E, Besson D, Burrows JN, Duffy J, Laleu B, Guantai EM, Leach AR..  (2023)  MAIP: An Open-Source Tool to Enrich High-Throughput Screening Output and Identify Novel, Druglike Molecules with Antimalarial Activity.,  14  (12): [PMID:38116432] [10.1021/acsmedchemlett.3c00369]

Source

Source(1):

Shall we send you a message when we have discounts available?

Remind me later

Thank you! Please check your email inbox to confirm.

Oops! Notifications are disabled.