Determine the necessary mass, volume, or concentration for preparing a solution.
analytical standard Padrão analítico for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 3 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 528774493 |
|---|---|
| Sorrisos canónicos | CC(C(=O)O)OC1=C(C=C(C=C1)Cl)Cl |
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)propanoic acid |
| InChIKey | MZHCENGPTKEIGP-RXMQYKEDSA-N |
| INCHI | 1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13)/t5-/m1/s1 |
| SMILES isoméricas | C[C@H](C(=O)O)OC1=C(C=C(C=C1)Cl)Cl |
| WGK Alemanha | 1 |
| RTECS | UA2458860 |
| Peso molecular | 235.06 |
| Beilstein | 5265110 |
| Reaxy-Rn | 3203103 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=3203103&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Classe | Benzene and substituted derivatives |
| Subclass | 2-phenoxypropionic acids |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2-phenoxypropionic acids |
| Alternative Parents | Phenoxyacetic acid derivatives Phenoxy compounds Phenol ethers Dichlorobenzenes Alkyl aryl ethers Aryl chlorides Monocarboxylic acids and derivatives Carboxylic acids Organochlorides Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | 2-phenoxypropionic acid - Phenoxyacetate - Phenoxy compound - Phenol ether - 1,3-dichlorobenzene - Alkyl aryl ether - Chlorobenzene - Halobenzene - Aryl chloride - Aryl halide - Carboxylic acid derivative - Carboxylic acid - Ether - Monocarboxylic acid or derivatives - Organooxygen compound - Organic oxygen compound - Carbonyl group - Organochloride - Organic oxide - Organohalogen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as 2-phenoxypropionic acids. These are aromatic compounds hat contain a phenol ether attached to the C2-atom of a phenylpropionic acid. |
| External Descriptors | 2-(2,4-dichlorophenoxy)propanoic acid |
| Ponto de fusão (°C) | 121-123°C |
|---|---|
| Peso molecular | 235.060 g/mol |
| XLogP3 | 3.400 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 3 |
| Exact Mass | 233.985 Da |
| Monoisotopic Mass | 233.985 Da |
| Topological Polar Surface Area | 46.500 Ų |
| Heavy Atom Count | 14 |
| Formal Charge | 0 |
| Complexity | 210.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 1 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Long Zhang, Man Song, Zhenbo Mao, Yuan Liu, Feng Li, Jiandong Jiang, Kai Chen. (2022) A new enantioselective dioxygenase for the (S)-enantiomer of the chiral herbicide dichlorprop in Sphingopyxis sp. DBS4. INTERNATIONAL BIODETERIORATION & BIODEGRADATION, [PMID:] [10.1016/j.ibiod.2022.105511] |
| 2. Shunli Hu, Guiping Liu, Long Zhang, Yufeng Gan, Baozhan Wang, Shiri Freilich, Jiandong Jiang. (2021) A Synergistic Consortium Involved in rac-Dichlorprop Degradation as Revealed by DNA Stable Isotope Probing and Metagenomic Analysis. APPLIED AND ENVIRONMENTAL MICROBIOLOGY, 87 (22): [PMID:34524896] [10.1128/AEM.01562-21] |
| 3. Xinyu Lin, Shifeng Ding, Wanxin Li, Bingang Yang, Yahua Chen, Zhenguo Shen, Jiandong Jiang, Chen Chen, Xihui Xu. (2026) Metabolic Modelling Facilitates the Design of Synthetic Communities by Simplifying Natural Microbial Communities. ENVIRONMENTAL MICROBIOLOGY, 28 (8): (e70404). [PMID:] [10.1111/1462-2920.70404] |
Our grade selection guide covers purity, stabilizer status, and application suitability for all variants in our catalog.
View Analytical standard grade guide →