≥90% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 6 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisos canónicos | CC(C)(C1CCC(CC1)O)C2CCC(CC2)O |
|---|---|
| IUPAC Name | 4-[2-(4-hydroxycyclohexyl)propan-2-yl]cyclohexan-1-ol |
| InChIKey | CDBAMNGURPMUTG-UHFFFAOYSA-N |
| INCHI | 1S/C15H28O2/c1-15(2,11-3-7-13(16)8-4-11)12-5-9-14(17)10-6-12/h11-14,16-17H,3-10H2,1-2H3 |
| SMILES isoméricas | CC(C)(C1CCC(CC1)O)C2CCC(CC2)O |
| WGK Alemanha | 3 |
| Peso molecular | 240.38 |
| Reaxy-Rn | 2043817 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=2043817&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Classe | Organooxygen compounds |
| Subclass | Alcohols and polyols |
| Intermediate Tree Nodes | Secondary alcohols |
| Direct Parent | Cyclohexanols |
| Alternative Parents | Cyclic alcohols and derivatives Hydrocarbon derivatives |
| Molecular Framework | Aliphatic homomonocyclic compounds |
| Substituents | Cyclohexanol - Cyclic alcohol - Hydrocarbon derivative - Aliphatic homomonocyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as cyclohexanols. These are compounds containing an alcohol group attached to a cyclohexane ring. |
| External Descriptors | Not available |
| Solubilidade | Insoluble in water; Soluble in alcohol |
|---|---|
| Ponto de ebulição (°C) | 230-234 °C/14 mmHg (lit.) |
| Peso molecular | 240.380 g/mol |
| XLogP3 | 3.300 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 2 |
| Exact Mass | 240.209 Da |
| Monoisotopic Mass | 240.209 Da |
| Topological Polar Surface Area | 40.500 Ų |
| Heavy Atom Count | 17 |
| Formal Charge | 0 |
| Complexity | 209.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Jian Zhang, Yanbo Zeng, Lifen Chen, Xiaoling Lei, Yiwen Yang, Zhidong Chen, Longhua Guo, Lei Li. (2023) A novel core-shell composite of PCN-222@MIPIL for ultrasensitive electrochemical sensing 4-nonylphenol. ENVIRONMENTAL RESEARCH, [PMID:36848978] [10.1016/j.envres.2023.115499] |
| 2. Yiyun Zhang, Wenwen Zhang, Liming Zhang, Guangsan Song, Ningwei Wang, Wanzhen Xu, Weihong Huang. (2021) A molecularly imprinted electrochemical BPA sensor based on multi-walled carbon nanotubes modified by CdTe quantum dots for the detection of bisphenol A. MICROCHEMICAL JOURNAL, [PMID:] [10.1016/j.microc.2021.106737] |
| 3. Xiaoling Lei, Ziyi Deng, Yanbo Zeng, Shisi Huang, Yiwen Yang, Hailong Wang, Longhua Guo, Lei Li. (2021) A novel composite of conductive metal organic framework and molecularly imprinted poly (ionic liquid) for highly sensitive electrochemical detection of bisphenol A. SENSORS AND ACTUATORS B-CHEMICAL, [PMID:] [10.1016/j.snb.2021.129885] |
| 4. Xiaogang Guo, Cheng-Hsin Lu, Huisheng Huang, Xun Cui, Taotao Liang, Binfang Yuan, Jing Wang, Xueming Li. (2020) Facilely controllable synthesis of multi-functional aluminum/nickel/perfluorosilane composites for enhancing the thermal energy release stability and enhancing anti-wetting properties. COMPOSITES SCIENCE AND TECHNOLOGY, [PMID:] [10.1016/j.compscitech.2020.108351] |
| 5. Yang Wan, Jia Li, Xi Wu, Pan Wu, Lin Zhang. (2025) Laccase Co3(PO4)2 hybrid nanoflowers and multi-walled carbon nanotubes-based electrochemical sensor for bisphenol A analysis. FOOD RESEARCH INTERNATIONAL, [PMID:41606904] [10.1016/j.foodres.2025.117052] |
| 6. Hongji Wang, Jian Wang, Hanyu Yao, Xiaoqing Hao, Yin Lv, Zhong Wei. (2025) Synthesis of high mechanical performance transparent polyester by copolymerization of hydrogenated bisphenol A and PBS. POLYMER, [PMID:] [10.1016/j.polymer.2025.129277] |
