Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C[N+](C)(C)CCOS(=O)(=O)[O-] |
|---|---|
| IUPAC Name | 2-(trimethylazaniumyl)ethyl sulfate |
| InChIKey | WXCQAWGXWVRCGP-UHFFFAOYSA-N |
| INCHI | 1S/C5H13NO4S/c1-6(2,3)4-5-10-11(7,8)9/h4-5H2,1-3H3 |
| Isómeros SMILES | C[N+](C)(C)CCOS(=O)(=O)[O-] |
| CAS alternativo | 4858-96-2 |
| PubChem CID | 485 |
| Número NSC | 46242 |
| Términos de entrada MeSH | 2-Hydroxy-N,N,N-trimethylethanaminium;Bitartrate, Choline;Bursine;Chloride, Choline;Choline;Choline Bitartrate;Choline Chloride;Choline Citrate;Choline Hydroxide;Choline O Sulfate;Choline O-Sulfate;Citrate, Choline;Fagine;Hydroxide, Choline;O-Sulfate, Cho |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Clase | Organic sulfuric acids and derivatives |
| Subclass | Sulfuric acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Sulfuric acid monoesters |
| Alternative Parents | Alkyl sulfates Tetraalkylammonium salts Organopnictogen compounds Organooxygen compounds Organic salts Organic oxides Hydrocarbon derivatives Amines |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Alkyl sulfate - Sulfate-ester - Sulfuric acid monoester - Tetraalkylammonium salt - Quaternary ammonium salt - Organic nitrogen compound - Organic oxygen compound - Organopnictogen compound - Organic oxide - Hydrocarbon derivative - Organic salt - Organooxygen compound - Organonitrogen compound - Amine - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as sulfuric acid monoesters. These are organic compounds containing the sulfuric acid monoester functional group, with the generic structure ROS(O)(=O)=O, (R=organyl group). |
| External Descriptors | a small molecule |
| Peso molecular | 183.230 g/mol |
|---|---|
| XLogP3 | -0.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 3 |
| Exact Mass | 183.057 Da |
| Monoisotopic Mass | 183.057 Da |
| Topological Polar Surface Area | 74.800 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 184.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |