Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1=CN(C(=O)N=C1N)[C@H]2[C@H]3[C@@H]([C@H](O2)CO)OP(=O)(O3)O |
|---|---|
| IUPAC Name | 1-[(3aR,4R,6R,6aR)-2-hydroxy-6-(hydroxymethyl)-2-oxo-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxaphosphol-4-yl]-4-aminopyrimidin-2-one |
| InChIKey | NMPZCCZXCOMSDQ-XVFCMESISA-N |
| INCHI | 1S/C9H12N3O7P/c10-5-1-2-12(9(14)11-5)8-7-6(4(3-13)17-8)18-20(15,16)19-7/h1-2,4,6-8,13H,3H2,(H,15,16)(H2,10,11,14)/t4-,6-,7-,8-/m1/s1 |
| Peso molecular | 305.180 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Nucleosides, nucleotides, and analogues |
| Clase | Pyrimidine nucleotides |
| Subclass | Cyclic pyrimidine nucleotides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | 2',3'-cyclic pyrimidine nucleotides |
| Alternative Parents | Ribonucleoside 3'-phosphates Pyrimidones Aminopyrimidines and derivatives Organic phosphoric acids and derivatives Monosaccharides Imidolactams Hydropyrimidines Tetrahydrofurans Dioxaphospholanes Heteroaromatic compounds Azacyclic compounds Oxacyclic compounds Hydrocarbon derivatives Organic oxides Organopnictogen compounds Primary alcohols Primary amines |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | 2',3'-cyclic pyrimidine ribonucleotide - Ribonucleoside 3'-phosphate - Aminopyrimidine - Pyrimidone - Hydropyrimidine - Monosaccharide - Organic phosphoric acid derivative - Pyrimidine - Imidolactam - Heteroaromatic compound - Tetrahydrofuran - 1,3_dioxaphospholane - Organoheterocyclic compound - Oxacycle - Azacycle - Organic oxide - Primary alcohol - Organooxygen compound - Organonitrogen compound - Amine - Alcohol - Organic nitrogen compound - Primary amine - Organic oxygen compound - Organopnictogen compound - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as 2',3'-cyclic pyrimidine nucleotides. These are pyrimidine nucleotides in which the oxygen atoms linked to the C2 and C3 carbon atoms of the ribose moiety are both bonded the same phosphorus atom of the phosphate group. |
| External Descriptors | 2',3'-Cyclic nucleotides |
| Peso molecular | 305.180 g/mol |
|---|---|
| XLogP3 | -3.300 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 7 |
| Rotatable Bond Count | 2 |
| Exact Mass | 305.041 Da |
| Monoisotopic Mass | 305.041 Da |
| Topological Polar Surface Area | 144.000 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 550.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |