Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | CC(CC(C(C=O)O)N(C)C)O |
|---|---|
| IUPAC Name | (2R,3S,5R)-3-(dimethylamino)-2,5-dihydroxyhexanal |
| InChIKey | VTJCSBJRQLZNHE-CSMHCCOUSA-N |
| INCHI | 1S/C8H17NO3/c1-6(11)4-7(9(2)3)8(12)5-10/h5-8,11-12H,4H2,1-3H3/t6-,7+,8+/m1/s1 |
| Isómeros SMILES | C[C@H](C[C@@H]([C@H](C=O)O)N(C)C)O |
| CAS alternativo | 5779-39-5 |
| PubChem CID | 168997 |
| Términos de entrada MeSH | D-desosamine;desosamine |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Clase | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Aminosaccharides |
| Alternative Parents | Monosaccharides Alpha-hydroxyaldehydes 1,3-aminoalcohols Trialkylamines Secondary alcohols Organopnictogen compounds Organic oxides Hydrocarbon derivatives |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Amino saccharide - Monosaccharide - 1,3-aminoalcohol - Alpha-hydroxyaldehyde - Secondary alcohol - Tertiary amine - Tertiary aliphatic amine - Alcohol - Organic nitrogen compound - Organonitrogen compound - Organopnictogen compound - Carbonyl group - Amine - Aldehyde - Organic oxide - Hydrocarbon derivative - Aliphatic acyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as aminosaccharides. These are saccharides containing a sugar unit that bears an amino group. |
| External Descriptors | amino sugar |
| Peso molecular | 175.230 g/mol |
|---|---|
| XLogP3 | -0.700 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 5 |
| Exact Mass | 175.121 Da |
| Monoisotopic Mass | 175.121 Da |
| Topological Polar Surface Area | 60.800 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 138.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 3 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |