Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| ALogP | 3 |
|---|
| Sonrisas canónicas | CC(C)NCCCC1(C2=CC=CC=C2C3=CC=CC=C31)C(=O)N |
|---|---|
| IUPAC Name | 9-[3-(propan-2-ylamino)propyl]fluorene-9-carboxamide |
| InChIKey | UCEWGESNIULAGX-UHFFFAOYSA-N |
| INCHI | 1S/C20H24N2O/c1-14(2)22-13-7-12-20(19(21)23)17-10-5-3-8-15(17)16-9-4-6-11-18(16)20/h3-6,8-11,14,22H,7,12-13H2,1-2H3,(H2,21,23) |
| Isómeros SMILES | CC(C)NCCCC1(C2=CC=CC=C2C3=CC=CC=C31)C(=O)N |
| PubChem CID | 52195 |
| Peso molecular | 308.4 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Benzenoids |
| Clase | Fluorenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fluorenes |
| Alternative Parents | Delta amino acids and derivatives Aralkylamines Fatty amides Primary carboxylic acid amides Dialkylamines Organopnictogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Substituents | Delta amino acid or derivatives - Fluorene - Aralkylamine - Fatty amide - Fatty acyl - Amino acid or derivatives - Carboxamide group - Primary carboxylic acid amide - Carboxylic acid derivative - Secondary aliphatic amine - Secondary amine - Hydrocarbon derivative - Organic oxide - Organic nitrogen compound - Organopnictogen compound - Amine - Organic oxygen compound - Carbonyl group - Organonitrogen compound - Organooxygen compound - Aromatic homopolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as fluorenes. These are compounds containing a fluorene moiety, which consists of two benzene rings connected through either a cyclopentane, cyclopentene, or cyclopenta-1,3-diene. |
| External Descriptors | Not available |
| Peso molecular | 308.400 g/mol |
|---|---|
| XLogP3 | 3.000 |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 6 |
| Exact Mass | 308.189 Da |
| Monoisotopic Mass | 308.189 Da |
| Topological Polar Surface Area | 55.100 Ų |
| Heavy Atom Count | 23 |
| Formal Charge | 0 |
| Complexity | 398.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |