Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 2 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sonrisas canónicas | C1COCCN1[N+]2=CC(=N)O[N-]2 |
|---|---|
| IUPAC Name | 3-morpholin-4-yl-1-oxa-3-azonia-2-azanidacyclopent-3-en-5-imine |
| InChIKey | FKDHHVKWGRFRTG-UHFFFAOYSA-N |
| INCHI | 1S/C6H10N4O2/c7-6-5-10(8-12-6)9-1-3-11-4-2-9/h5,7H,1-4H2 |
| Isómeros SMILES | C1COCCN1[N+]2=CC(=N)O[N-]2 |
| PubChem CID | 5219 |
| Peso molecular | 170.17 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Oxazinanes |
| Subclass | Morpholines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Morpholines |
| Alternative Parents | Heteroaromatic compounds 1,2,3-oxadiazoles Oxacyclic compounds Dialkyl ethers Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Morpholine - Azole - Oxadiazole - 1,2,3-oxadiazole - Heteroaromatic compound - Oxacycle - Azacycle - Dialkyl ether - Ether - Organooxygen compound - Organonitrogen compound - Organic nitrogen compound - Hydrocarbon derivative - Organopnictogen compound - Organic oxygen compound - Aromatic heteromonocyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as morpholines. These are organic compounds containing a morpholine moiety, which consists of a six-member aliphatic saturated ring with the formula C4H9NO, where the oxygen and nitrogen atoms lie at positions 1 and 4, respectively. |
| External Descriptors | Not available |
| Peso molecular | 170.170 g/mol |
|---|---|
| XLogP3 | 0.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 1 |
| Exact Mass | 170.08 Da |
| Monoisotopic Mass | 170.08 Da |
| Topological Polar Surface Area | 49.600 Ų |
| Heavy Atom Count | 12 |
| Formal Charge | 0 |
| Complexity | 222.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
| 1. Meili Yang, Zuzhe Kang, Xinpei Zhong, Sirui Bai, Dong-En Wang, Qin Tu, Sheng Chen, Jinyi Wang, Mao-Sen Yuan. (2025) Visualizing GSH-ONOO− Redox and Tracking Lesion-Remedy of Acute Kidney Oxidative Injury Based on a Dual-Site Chemosensor. Advanced Healthcare Materials, [PMID:40424091] [10.1002/adhm.202500907] |
| 2. Bin Yin, Yi Chen Xu, Yong Lu. (2025) Oxidative stress-mediated apoptosis via the SLC23A2-ascorbic acid interaction contributes to cleft lip development. Frontiers in Pediatrics, [PMID:41113559] [10.3389/fped.2025.1632778] |