Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | CC1=CC2=C(C=C1)SC3=C(S2)C=CC(=C3)C |
|---|---|
| IUPAC Name | 2,7-dimethylthianthrene |
| InChIKey | AHXDSVSZEZHDLV-UHFFFAOYSA-N |
| INCHI | 1S/C14H12S2/c1-9-3-5-11-13(7-9)15-12-6-4-10(2)8-14(12)16-11/h3-8H,1-2H3 |
| Isomeric SMILES | CC1=CC2=C(C=C1)SC3=C(S2)C=CC(=C3)C |
| PubChem CID | 667491 |
| Molecular Weight | 244.38 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Class | Benzodithiins |
| Subclass | 1,4-benzodithiins |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Thianthrenes |
| Alternative Parents | Diarylthioethers Benzenoids Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Thianthrene - Diarylthioether - Aryl thioether - Benzenoid - Thioether - Hydrocarbon derivative - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as thianthrenes. These are organic compounds containing a thianthrene moiety. Thianthrene is a tricyclic ring system that consists of two benzene rings fused to each other through a 1,4-dithiin ring. |
| External Descriptors | Not available |
| Molecular Weight | 244.400 g/mol |
|---|---|
| XLogP3 | 4.900 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 0 |
| Exact Mass | 244.038 Da |
| Monoisotopic Mass | 244.038 Da |
| Topological Polar Surface Area | 50.600 Ų |
| Heavy Atom Count | 16 |
| Formal Charge | 0 |
| Complexity | 227.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |