Determine the necessary mass, volume, or concentration for preparing a solution.
10mM in DMSO for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at -80°C Ships Dry ice packs + Cold packs Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
Information
UBCS039 UBCS039 is the first synthetic SIRT6 activator with EC50 of 38 μM,induces a time-dependent activation of autophagy in several human tumor cell lines.
Targets
SIRT6 (Cell-free assay) 38 μM(EC50)
In vitro
UBCS039 induces deacetylation of SIRT6-targeted histone H3 sites in human cancer cells.UBCS039 leads to autophagosome accumulation and induces autophagic flux in human cancer cells.UBCS039 also induces autophagy-associated cell death.
Cell Research(from reference)
Cell lines:HeLa cells
Concentrations:100\u2009µM
Incubation Time:24\u2009h
| ALogP | 2.914 |
|---|---|
| Recuento HBD | 1 |
| Enlace rotable | 1 |
| Pubchem Sid | 528767565 |
|---|---|
| Sonrisas canónicas | C1=CC=C2C(=C1)NC(C3=CC=CN32)C4=CN=CC=C4 |
| IUPAC Name | 4-pyridin-3-yl-4,5-dihydropyrrolo[1,2-a]quinoxaline |
| InChIKey | BSOBGTYXYGHUTD-UHFFFAOYSA-N |
| INCHI | 1S/C16H13N3/c1-2-7-14-13(6-1)18-16(12-5-3-9-17-11-12)15-8-4-10-19(14)15/h1-11,16,18H |
| Isómeros SMILES | C1=CC=C2C(=C1)NC(C3=CC=CN32)C4=CN=CC=C4 |
| PubChem CID | 2803797 |
| Peso molecular | 247.29 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Clase | Diazanaphthalenes |
| Subclass | Benzodiazines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Quinoxalines |
| Alternative Parents | Secondary alkylarylamines Aralkylamines Pyridines and derivatives Benzenoids Pyrroles Heteroaromatic compounds Azacyclic compounds Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Quinoxaline - Aralkylamine - Secondary aliphatic/aromatic amine - Benzenoid - Pyridine - Heteroaromatic compound - Pyrrole - Azacycle - Secondary amine - Organic nitrogen compound - Organopnictogen compound - Hydrocarbon derivative - Organonitrogen compound - Amine - Aromatic heteropolycyclic compound |
| Descripción | This compound belongs to the class of organic compounds known as quinoxalines. These are compounds containing a quinoxaline moiety, a bicyclic heterocycle made up of a benzene ring fused to a pyrazine ring. |
| External Descriptors | Not available |
| DMSO (mg/ml) Solubilidad máxima | 49 |
|---|---|
| DMSO (mM) Solubilidad máxima | 198.147923490639 |
| Agua (mg/ml) Solubilidad máxima | <1 |
| Peso molecular | 247.290 g/mol |
| XLogP3 | 2.500 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 247.111 Da |
| Monoisotopic Mass | 247.111 Da |
| Topological Polar Surface Area | 29.900 Ų |
| Heavy Atom Count | 19 |
| Formal Charge | 0 |
| Complexity | 319.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |