Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships FedEx DG Service Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 1 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | [O-]I(=O)=O.[O-]I(=O)=O.[Ca+2] |
|---|---|
| IUPAC Name | calcium;diiodate |
| InChIKey | UHWJJLGTKIWIJO-UHFFFAOYSA-L |
| INCHI | 1S/Ca.2HIO3/c;2*2-1(3)4/h;2*(H,2,3,4)/q+2;;/p-2 |
| Isomeric SMILES | [O-]I(=O)=O.[O-]I(=O)=O.[Ca+2] |
| WGK Germany | 3 |
| PubChem CID | 24619 |
| UN Number | 1479 |
| Molecular Weight | 389.88 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Inorganic compounds |
|---|---|
| Superclass | Mixed metal/non-metal compounds |
| Class | Alkaline earth metal oxoanionic compounds |
| Subclass | Alkaline earth metal iodates |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Alkaline earth metal iodates |
| Alternative Parents | Inorganic oxides Inorganic calcium salts |
| Molecular Framework | Not available |
| Substituents | Alkaline earth metal iodate - Inorganic calcium salt - Inorganic oxide - Inorganic salt |
| Description | This compound belongs to the class of inorganic compounds known as alkaline earth metal iodates. These are inorganic compounds in which the largest oxoanion is iodate, and in which the heaviest atom not in an oxoanion is an alkaline earth metal. |
| External Descriptors | Not available |
| Sensitivity | Moisture sensitive. |
|---|---|
| Molecular Weight | 389.880 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 6 |
| Rotatable Bond Count | 0 |
| Exact Mass | 389.741 Da |
| Monoisotopic Mass | 389.741 Da |
| Topological Polar Surface Area | 114.000 Ų |
| Heavy Atom Count | 9 |
| Formal Charge | 0 |
| Complexity | 36.500 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 3 |
| 1. Chao Shi, Liang Hu, Xinhang Liu, Lang Chen. (2023) Mg-based reactive materials with high iodine concentration and biocidal characteristics of aerosolized Mg-based biocidal materials. PROPELLANTS EXPLOSIVES PYROTECHNICS, 48 (10): (e202300149). [PMID:] [10.1002/prep.202300149] |