Determine the necessary mass, volume, or concentration for preparing a solution.
≥95% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Canonical Smiles | C1C(OC2=CC=CC=C2C1=NN)C3=CC=CC=C3 |
|---|---|
| IUPAC Name | (E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)hydrazine |
| InChIKey | LTYOJFOTFBGRPP-GHRIWEEISA-N |
| INCHI | 1S/C15H14N2O/c16-17-13-10-15(11-6-2-1-3-7-11)18-14-9-5-4-8-12(13)14/h1-9,15H,10,16H2/b17-13+ |
| Isomeric SMILES | C\1C(OC2=CC=CC=C2/C1=N/N)C3=CC=CC=C3 |
| PubChem CID | 5465885 |
| Molecular Weight | 238.28 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Phenylpropanoids and polyketides |
| Class | Flavonoids |
| Subclass | Flavans |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Flavans |
| Alternative Parents | 1-benzopyrans Alkyl aryl ethers Benzene and substituted derivatives Oxacyclic compounds Hydrazones Organopnictogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Flavan - Chromane - Benzopyran - 1-benzopyran - Alkyl aryl ether - Monocyclic benzene moiety - Benzenoid - Ether - Oxacycle - Hydrazone - Organoheterocyclic compound - Organic nitrogen compound - Hydrocarbon derivative - Organic oxygen compound - Organonitrogen compound - Organooxygen compound - Organopnictogen compound - Aromatic heteropolycyclic compound |
| Description | This compound belongs to the class of organic compounds known as flavans. These are compounds containing a flavan moiety, with a structure characterized by a 2-phenyl-3,4-dihydro-2H-1-benzopyran skeleton. |
| External Descriptors | Not available |
| Molecular Weight | 238.280 g/mol |
|---|---|
| XLogP3 | 2.800 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 238.111 Da |
| Monoisotopic Mass | 238.111 Da |
| Topological Polar Surface Area | 47.600 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 310.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 1 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 1 |
| Covalently-Bonded Unit Count | 1 |