Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisos canónicos | C(C1C(C(C(O1)CO)O)O)O |
|---|---|
| IUPAC Name | (2R,3S,4S,5R)-2,5-bis(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | MCHWWJLLPNDHGL-KVTDHHQDSA-N |
| INCHI | 1S/C6H12O5/c7-1-3-5(9)6(10)4(2-8)11-3/h3-10H,1-2H2/t3-,4-,5-,6-/m1/s1 |
| SMILES isoméricas | C([C@@H]1[C@H]([C@@H]([C@H](O1)CO)O)O)O |
| WGK Alemanha | 3 |
| Peso molecular | 164.16 |
| Reaxy-Rn | 15056685 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=15056685&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic oxygen compounds |
| Classe | Organooxygen compounds |
| Subclass | Carbohydrates and carbohydrate conjugates |
| Intermediate Tree Nodes | Glycosyl compounds |
| Direct Parent | C-glycosyl compounds |
| Alternative Parents | Pentoses Tetrahydrofurans Secondary alcohols Oxacyclic compounds Dialkyl ethers Primary alcohols Hydrocarbon derivatives |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Substituents | C-glycosyl compound - Pentose monosaccharide - Monosaccharide - Tetrahydrofuran - Secondary alcohol - Oxacycle - Organoheterocyclic compound - Ether - Dialkyl ether - Hydrocarbon derivative - Primary alcohol - Alcohol - Aliphatic heteromonocyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as c-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a C-glycosidic bond. |
| External Descriptors | Not available |
| Índice de refração | n20D1.56 (Predicted) |
|---|---|
| Rotação específica [α] | α20/D +56.7°, c = 1 in water |
| Ponto de ebulição (°C) | 416.24° C at 760 mmHg (Predicted) |
| Ponto de fusão (°C) | 101-103° C (lit.) |
| Peso molecular | 164.160 g/mol |
| XLogP3 | -1.500 |
| Hydrogen Bond Donor Count | 4 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 2 |
| Exact Mass | 164.068 Da |
| Monoisotopic Mass | 164.068 Da |
| Topological Polar Surface Area | 90.200 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 114.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 4 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |