Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisos canónicos | C1C2CC3CC1CC(C2)C3N=[N+]=[N-] |
|---|---|
| IUPAC Name | 2-azidoadamantane |
| InChIKey | DBMHNOXGUUDEPE-UHFFFAOYSA-N |
| INCHI | 1S/C10H15N3/c11-13-12-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-10H,1-5H2 |
| Peso molecular | 177.25 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic 1,3-dipolar compounds |
| Classe | Allyl-type 1,3-dipolar organic compounds |
| Subclass | Azo imides |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azo imides |
| Alternative Parents | Azo compounds Organic salts Hydrocarbon derivatives Organic cations |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Substituents | Azo imide - Azo compound - Organic nitrogen compound - Hydrocarbon derivative - Organic salt - Organonitrogen compound - Organic cation - Aliphatic homopolycyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as azo imides. These are n-Imides of azo compounds, analogous to azoxy compounds, having a delocalized structure. |
| External Descriptors | Not available |
| Peso molecular | 177.250 g/mol |
|---|---|
| XLogP3 | 3.500 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 2 |
| Rotatable Bond Count | 1 |
| Exact Mass | 177.127 Da |
| Monoisotopic Mass | 177.127 Da |
| Topological Polar Surface Area | 14.400 Ų |
| Heavy Atom Count | 13 |
| Formal Charge | 0 |
| Complexity | 239.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |