Determine the necessary mass, volume, or concentration for preparing a solution.
≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
3-Hydroxy sebacic acid is a dicarboxylic secondary alcohol fatty acid derivative that is present in urine as a 3-hydroxydicarboxylic acid metabolite.
| Pubchem Sid | 508809085 |
|---|---|
| Sorrisos canónicos | C(CCCC(=O)O)CCC(CC(=O)O)O |
| IUPAC Name | 3-hydroxydecanedioic acid |
| InChIKey | OQYZCCKCJQWHIE-UHFFFAOYSA-N |
| INCHI | 1S/C10H18O5/c11-8(7-10(14)15)5-3-1-2-4-6-9(12)13/h8,11H,1-7H2,(H,12,13)(H,14,15) |
| SMILES isoméricas | C(CCCC(=O)O)CCC(CC(=O)O)O |
| Peso molecular | 218.25 |
| Reaxy-Rn | 10676440 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=10676440&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organic acids and derivatives |
| Classe | Hydroxy acids and derivatives |
| Subclass | Medium-chain hydroxy acids and derivatives |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Medium-chain hydroxy acids and derivatives |
| Alternative Parents | Medium-chain fatty acids Hydroxy fatty acids Beta hydroxy acids and derivatives Dicarboxylic acids and derivatives Secondary alcohols Carboxylic acids Organic oxides Hydrocarbon derivatives Carbonyl compounds |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Medium-chain hydroxy acid - Medium-chain fatty acid - Beta-hydroxy acid - Hydroxy fatty acid - Dicarboxylic acid or derivatives - Fatty acyl - Fatty acid - Secondary alcohol - Carboxylic acid - Carboxylic acid derivative - Organooxygen compound - Hydrocarbon derivative - Organic oxide - Alcohol - Carbonyl group - Organic oxygen compound - Aliphatic acyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as medium-chain hydroxy acids and derivatives. These are hydroxy acids with a 6 to 12 carbon atoms long side chain. |
| External Descriptors | Dicarboxylic acids |
| Índice de refração | n20D1.50 (Predicted) |
|---|---|
| Ponto de ebulição (°C) | ~426.6° C at 760 mmHg (Predicted) |
| Ponto de fusão (°C) | 151.80° C (Predicted) |
| Peso molecular | 218.250 g/mol |
| XLogP3 | 0.800 |
| Hydrogen Bond Donor Count | 3 |
| Hydrogen Bond Acceptor Count | 5 |
| Rotatable Bond Count | 9 |
| Exact Mass | 218.115 Da |
| Monoisotopic Mass | 218.115 Da |
| Topological Polar Surface Area | 94.800 Ų |
| Heavy Atom Count | 15 |
| Formal Charge | 0 |
| Complexity | 202.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 1 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |