≥97% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisos canónicos | CCCC[Sn](CCCC)(CCCC)C1=NC=CC(=C1)C |
|---|---|
| IUPAC Name | tributyl-(4-methylpyridin-2-yl)stannane |
| InChIKey | SHMPGQWVDZTZBX-UHFFFAOYSA-N |
| INCHI | 1S/C6H6N.3C4H9.Sn/c1-6-2-4-7-5-3-6;3*1-3-4-2;/h2-4H,1H3;3*1,3-4H2,2H3; |
| SMILES isoméricas | CCCC[Sn](CCCC)(CCCC)C1=NC=CC(=C1)C |
| PubChem CID | 11222775 |
| Peso molecular | 382.16 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Classe | Pyridines and derivatives |
| Subclass | Methylpyridines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Methylpyridines |
| Alternative Parents | Metal aryls Heteroaromatic compounds Trialkyltins Azacyclic compounds Organonitrogen compounds Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteromonocyclic compounds |
| Substituents | Methylpyridine - Metal aryl - Heteroaromatic compound - Trialkyltin - Azacycle - Organic nitrogen compound - Hydrocarbon derivative - Organotin compound - Organonitrogen compound - Organometallic compound - Organic post-transition metal moeity - Aromatic heteromonocyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as methylpyridines. These are organic compounds containing a pyridine ring substituted at one or more positions by a methyl group. |
| External Descriptors | Not available |
| Peso molecular | 382.200 g/mol |
|---|---|
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 1 |
| Rotatable Bond Count | 10 |
| Exact Mass | 383.164 Da |
| Monoisotopic Mass | 383.164 Da |
| Topological Polar Surface Area | 12.900 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 220.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |
I2616780