Determine the necessary mass, volume, or concentration for preparing a solution.
≥98% for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Armazenar a 2-8°C,Protegido da luz,Carregado com árgon Ships Gelo húmido Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisos canónicos | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)CBr |
|---|---|
| IUPAC Name | 2-bromo-1-(4-phenyldiazenylphenyl)ethanone |
| InChIKey | ZXTGCMLCYPYCID-UHFFFAOYSA-N |
| INCHI | 1S/C14H11BrN2O/c15-10-14(18)11-6-8-13(9-7-11)17-16-12-4-2-1-3-5-12/h1-9H,10H2 |
| SMILES isoméricas | C1=CC=C(C=C1)N=NC2=CC=C(C=C2)C(=O)CBr |
| PubChem CID | 112886 |
| Peso molecular | 303.16 |
| Reaxy-Rn | 914273 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Classe | Azobenzenes |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Azobenzenes |
| Alternative Parents | Alkyl-phenylketones Benzoyl derivatives Aryl alkyl ketones Alpha-haloketones Azo compounds Propargyl-type 1,3-dipolar organic compounds Organopnictogen compounds Organobromides Organic oxides Hydrocarbon derivatives Alkyl bromides |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Substituents | Azobenzene - Alkyl-phenylketone - Phenylketone - Benzoyl - Aryl ketone - Aryl alkyl ketone - Monocyclic benzene moiety - Benzenoid - Alpha-haloketone - Azo compound - Ketone - Organic 1,3-dipolar compound - Propargyl-type 1,3-dipolar organic compound - Organic oxide - Organic nitrogen compound - Organooxygen compound - Organonitrogen compound - Organobromide - Organohalogen compound - Alkyl halide - Organic oxygen compound - Alkyl bromide - Organopnictogen compound - Hydrocarbon derivative - Aromatic homomonocyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as azobenzenes. These are organonitrogen aromatic compounds that contain a central azo group, where each nitrogen atom is conjugated to a benzene ring. |
| External Descriptors | Not available |
| Sensibilidade | light & air sensitive |
|---|---|
| Ponto de fusão (°C) | 104 °C |
| Peso molecular | 303.150 g/mol |
| XLogP3 | 4.600 |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 4 |
| Exact Mass | 302.005 Da |
| Monoisotopic Mass | 302.005 Da |
| Topological Polar Surface Area | 41.800 Ų |
| Heavy Atom Count | 18 |
| Formal Charge | 0 |
| Complexity | 292.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |