Determine the necessary mass, volume, or concentration for preparing a solution.
0.5M in THF for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Store at 2-8°C,Argon charged Ships Wet ice Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Pubchem Sid | 508809841 |
|---|---|
| Sorrisos canónicos | CCOC(=O)CCC[CH2-].[Zn+]Br |
| IUPAC Name | bromozinc(1+);ethyl pentanoate |
| InChIKey | JJSSUZYKRQXNFR-UHFFFAOYSA-M |
| INCHI | 1S/C7H13O2.BrH.Zn/c1-3-5-6-7(8)9-4-2;;/h1,3-6H2,2H3;1H;/q-1;;+2/p-1 |
| SMILES isoméricas | CCOC(=O)CCC[CH2-].[Zn+]Br |
| PubChem CID | 3260042 |
| Peso molecular | 274.46 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Lipids and lipid-like molecules |
| Classe | Fatty Acyls |
| Subclass | Fatty acid esters |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Fatty acid esters |
| Alternative Parents | Carboxylic acid esters Organic transition metal salts Organic metal halides Organic metal bromide salts Monocarboxylic acids and derivatives Organic oxides Organic bromide salts Hydrocarbon derivatives Carbonyl compounds Organic cations |
| Molecular Framework | Aliphatic acyclic compounds |
| Substituents | Fatty acid ester - Carboxylic acid ester - Carboxylic acid derivative - Organic metal halide - Monocarboxylic acid or derivatives - Organic transition metal salt - Organic metal salt - Organic metal bromide salt - Organic salt - Organooxygen compound - Organic bromide salt - Organic oxygen compound - Carbonyl group - Hydrocarbon derivative - Organic oxide - Organic cation - Aliphatic acyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as fatty acid esters. These are carboxylic ester derivatives of a fatty acid. |
| External Descriptors | Not available |
| Sensibilidade | Air sensitive |
|---|---|
| Peso molecular | 274.500 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 0 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 5 |
| Exact Mass | 271.939 Da |
| Monoisotopic Mass | 271.939 Da |
| Topological Polar Surface Area | 26.300 Ų |
| Heavy Atom Count | 11 |
| Formal Charge | 0 |
| Complexity | 88.500 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |