Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Normal Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisos canónicos | CC1=CC2=C(C=C1N)N=C3C=C(C=CC3=C2)N(C)C.Cl |
|---|---|
| IUPAC Name | 6-N,6-N,2-trimethylacridine-3,6-diamine;hydrochloride |
| InChIKey | JRMDFAKCPRMZKA-UHFFFAOYSA-N |
| INCHI | 1S/C16H17N3.ClH/c1-10-6-12-7-11-4-5-13(19(2)3)8-15(11)18-16(12)9-14(10)17;/h4-9H,17H2,1-3H3;1H |
| SMILES isoméricas | CC1=CC2=C(C=C1N)N=C3C=C(C=CC3=C2)N(C)C.Cl |
| Peso molecular | 287.79 |
| Reaxy-Rn | 6018611 |
| Reaxys-RN_link_address | https://www.reaxys.com/reaxys/secured/hopinto.do?context=S&query=IDE.XRN=6018611&ln= |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Classe | Quinolines and derivatives |
| Subclass | Benzoquinolines |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Acridines |
| Alternative Parents | Aminoquinolines and derivatives Tertiary alkylarylamines Pyridines and derivatives Benzenoids Heteroaromatic compounds Azacyclic compounds Primary amines Organopnictogen compounds Organic chloride salts Hydrocarbon derivatives |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Acridine - Aminoquinoline - Tertiary aliphatic/aromatic amine - Pyridine - Benzenoid - Heteroaromatic compound - Tertiary amine - Azacycle - Organic chloride salt - Organic nitrogen compound - Hydrocarbon derivative - Primary amine - Organonitrogen compound - Organopnictogen compound - Amine - Organic salt - Aromatic heteropolycyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as acridines. These are organic compounds containing the acridine moiety, a linear tricyclic heterocycle which consists of two benzene rings joined by a pyridine ring. |
| External Descriptors | Not available |
| Solubilidade | Soluble in water, ethanol |
|---|---|
| Peso molecular | 287.790 g/mol |
| XLogP3 | |
| Hydrogen Bond Donor Count | 2 |
| Hydrogen Bond Acceptor Count | 3 |
| Rotatable Bond Count | 1 |
| Exact Mass | 287.119 Da |
| Monoisotopic Mass | 287.119 Da |
| Topological Polar Surface Area | 42.200 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 317.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 2 |