Determine the necessary mass, volume, or concentration for preparing a solution.
for sensitive chromatographic and analytical workflows requiring minimal baseline interference.
Room temperature Ships Check lot-specific COA for exact specifications.
SDS, COA, datasheet, and spec sheet available for download. Lot-specific COA accessible via lot number lookup.
Cited in 0 peer-reviewed publications across chromatography, organic synthesis, and cross-coupling reactions.
| Sorrisos canónicos | CC(C)(C1=CC2=CC(=C3C=COC=CC3=C2O1)OC)O |
|---|---|
| IUPAC Name | 2-(5-methoxyfuro[3,2-i][3]benzoxepin-2-yl)propan-2-ol |
| InChIKey | KXZSEWYHQCKWLI-UHFFFAOYSA-N |
| INCHI | 1S/C16H16O4/c1-16(2,17)14-9-10-8-13(18-3)11-4-6-19-7-5-12(11)15(10)20-14/h4-9,17H,1-3H3 |
| SMILES isoméricas | CC(C)(C1=CC2=CC(=C3C=COC=CC3=C2O1)OC)O |
| PubChem CID | 10084612 |
Comprehensive hazard, handling, storage, and regulatory compliance document.
Download SDS →Lot-specific quality data. Enter your lot number to retrieve the exact COA.
Look up COA →Full quality attributes and acceptance criteria for this grade.
View spec sheet →Taxonomy Tree
| Kingdom | Organic compounds |
|---|---|
| Superclass | Organoheterocyclic compounds |
| Classe | Benzoxepines |
| Subclass | Not available |
| Intermediate Tree Nodes | Not available |
| Direct Parent | Benzoxepines |
| Alternative Parents | Benzofurans Anisoles Alkyl aryl ethers Tertiary alcohols Heteroaromatic compounds Furans Oxacyclic compounds Hydrocarbon derivatives Aromatic alcohols |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Substituents | Benzoxepine - Benzofuran - Anisole - Phenol ether - Alkyl aryl ether - Benzenoid - Tertiary alcohol - Furan - Heteroaromatic compound - Ether - Oxacycle - Alcohol - Organooxygen compound - Hydrocarbon derivative - Organic oxygen compound - Aromatic alcohol - Aromatic heteropolycyclic compound |
| Descrição | This compound belongs to the class of organic compounds known as benzoxepines. These are organic compounds containing a benzene ring fused to an oxepine ring (an unsaturated seven-membered heterocycle with one oxygen atom replacing a carbon atom). |
| External Descriptors | Not available |
| Peso molecular | 272.290 g/mol |
|---|---|
| XLogP3 | 2.600 |
| Hydrogen Bond Donor Count | 1 |
| Hydrogen Bond Acceptor Count | 4 |
| Rotatable Bond Count | 2 |
| Exact Mass | 272.105 Da |
| Monoisotopic Mass | 272.105 Da |
| Topological Polar Surface Area | 51.800 Ų |
| Heavy Atom Count | 20 |
| Formal Charge | 0 |
| Complexity | 415.000 |
| Isotope Atom Count | 0 |
| Defined Atom Stereocenter Count | 0 |
| Undefined Atom Stereocenter Count | 0 |
| Defined Bond Stereocenter Count | 0 |
| Undefined Bond Stereocenter Count | 0 |
| The total count of all stereochemical bonds | 0 |
| Covalently-Bonded Unit Count | 1 |